3-Aminopyrrolidine-3-carboxylic acid
PubChem CID: 415763
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 3-AMINOPYRROLIDINE-3-CARBOXYLIC ACID, 80546-88-9, Cucurbitin chloride, MFCD08234553, 3-AMINOPYRROLIDINE-3-CARBOXYLICACID, 3-Amino-3-pyrrolidinecarboxylic acid, 3-Amino-3-carboxypyrrolidin, SCHEMBL1433577, DWAKXSZUASEUHH-UHFFFAOYSA-N, DTXSID301001309, CS-M0821, AKOS015854697, AB43590, AS-48174, SY318710, 3-Amino-3-pyrrolidinecarboxylic acid, 95%, DB-010109, (+/-)-3-amino-3-pyrrolidinecarboxylic acid, A67259, EN300-171552, F19621 |
|---|---|
| Topological Polar Surface Area | 75.4 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | DWAKXSZUASEUHH-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | 3-AMINOPYRROLIDINE-3-carboxylate |
| Heavy Atom Count | 9.0 |
| Compound Name | 3-Aminopyrrolidine-3-carboxylic acid |
| Kingdom | Organic compounds |
| Description | Cucurbitin is a member of the class of compounds known as alpha amino acids. Alpha amino acids are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Cucurbitin is soluble (in water) and a moderately acidic compound (based on its pKa). Cucurbitin can be found in cucumber and muskmelon, which makes cucurbitin a potential biomarker for the consumption of these food products. Cucurbitin is an amino acid and a carboxypyrrolidine that is found in Cucurbita seeds. Cucurbitin causes degenerative changes in the reproductive organs of parasitic flatworms called flukes . |
| Exact Mass | 130.074 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 130.074 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 137.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 130.15 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-aminopyrrolidine-3-carboxylic acid |
| Total Atom Stereocenter Count | 1.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Carboxylic acids and derivatives |
| Inchi | InChI=1S/C5H10N2O2/c6-5(4(8)9)1-2-7-3-5/h7H,1-3,6H2,(H,8,9) |
| Smiles | C1CNCC1(C(=O)O)N |
| Xlogp | -3.8 |
| Superclass | Organic acids and derivatives |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Amino acids, peptides, and analogues |
| Taxonomy Direct Parent | Alpha amino acids |
| Molecular Formula | C5H10N2O2 |
- 1. Outgoing r'ship
FOUND_INto/from Cucumis Melo (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Cucumis Sativus (Plant) Rel Props:Source_db:fooddb_chem_all