Dextran
PubChem CID: 4125253
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | DEXTRAN, 9004-54-0, Dextran 40, 2,3,4,5-tetrahydroxy-6-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal, Macrodex, Hexopyranosyl-(1->6)hexopyranosyl-(1->6)hexose, Dextran 70, 6-O-(6-O-beta-D-Glucopyranosyl-beta-D-glucopyranosyl)-D-glucose, Dextran T40, Dextran-500kd, Dextran (Mw 150000), SCHEMBL12557981, Dextran powder, Mw ~ 10000, Dextran powder, Mw ~ 2,500, Dextran powder, Mw ~ 6,000, DTXSID00864149, FZWBNHMXJMCXLU-UHFFFAOYSA-N, Dextran powder, Mw ~ 20,000, Dextran powder, Mw ~ 40,000, Dextran powder, Mw ~ 70,000, (2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal, BCP13568, Dextran powder, Mw ~ 100,000, Dextran powder, Mw ~ 150,000, Dextran powder, Mw ~ 500,000, AKOS015915689, DA-72707, D1448, D1449, DEX 500, Detrax 40, Dextranen, Dextraven, G72625, Dextran powder, Mw ~175,000 to 275,000, Dextran solution (20 % (w/w) (Autoclaved)) from Leuconostoc mesenteroides, average mol wt ~500,000 |
|---|---|
| Topological Polar Surface Area | 277.0 |
| Hydrogen Bond Donor Count | 11.0 |
| Heavy Atom Count | 34.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 625.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P02749, P09327, A0A0H2UNG0, Q9F930, A0A0H2ZL64, Q01339, C7H4X2 |
| Iupac Name | 2,3,4,5-tetrahydroxy-6-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Class | Fatty Acyls |
| Xlogp | -7.2 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty acyl glycosides |
| Molecular Formula | C18H32O16 |
| Prediction Swissadme | 0.0 |
| Inchi Key | FZWBNHMXJMCXLU-UHFFFAOYSA-N |
| Fcsp3 | 0.9444444444444444 |
| Logs | 0.724 |
| Rotatable Bond Count | 11.0 |
| Logd | -3.163 |
| Synonyms | Manninotriose, Dextran 80, Dextran b-1355, Dextran m 70, Dextran T 500, Dextran T 70, Dextrans, Rheomacrodex, Dextran 70, Dextran 75, Dextran b 1355 S, Dextran b1355, Dextran T-500, Hyskon, Polyglucin, Rondex, Dextran 40000, Dextran b 1355, Dextran T-40, Infukoll, Rheodextran, Rheoisodex, Dextran 40, Dextran b-1355-S, Dextran b512, Dextran derivatives, Dextran T 40, Hemodex, Macrodex, Promit, Rheopolyglucin, Saviosol, Dextran |
| Compound Name | Dextran |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 504.169 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 504.169 |
| Hydrogen Bond Acceptor Count | 16.0 |
| Molecular Weight | 504.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 14.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Esol | 2.275584399999999 |
| Inchi | InChI=1S/C18H32O16/c19-1-5(21)9(23)10(24)6(22)3-31-17-16(30)14(28)12(26)8(34-17)4-32-18-15(29)13(27)11(25)7(2-20)33-18/h1,5-18,20-30H,2-4H2 |
| Smiles | C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OCC(C(C(C(C=O)O)O)O)O)O)O)O)O)O)O)O |
| Nring | 2.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Fatty acyl glycosides of mono- and disaccharides |
- 1. Outgoing r'ship
FOUND_INto/from Panax Notoginseng (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all