CID 375682
PubChem CID: 375682
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | SCHEMBL2721242, CHEMBL1997745, NSC655524, AKOS032948514, NSC-655524, NCI60_019296, Q4734921, B0005-188645, (2R,3R,10R,11R,18S,19S)-3,11,19-tris(4-hydroxyphenyl)-4,12,20-trioxaheptacyclo[16.6.1.1^{2,5.1^{10,13.0^{21,25.0^{9,27.0^{17,26]heptacosa-1(25),5,7,9(27),13,15,17(26),21,23-nonaene-7,15,23-triol |
|---|---|
| Topological Polar Surface Area | 149.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Heavy Atom Count | 51.0 |
| Description | Constituent of Vitis vinifera (wine grape). alpha-Viniferin is found in alcoholic beverages, fruits, and common grape. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1080.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P22309, P0DMM9 |
| Iupac Name | 3,11,19-tris(4-hydroxyphenyl)-4,12,20-trioxaheptacyclo[16.6.1.12,5.110,13.021,25.09,27.017,26]heptacosa-1(25),5,7,9(27),13,15,17(26),21,23-nonaene-7,15,23-triol |
| Prediction Hob | 0.0 |
| Class | 2-arylbenzofuran flavonoids |
| Xlogp | 6.8 |
| Superclass | Phenylpropanoids and polyketides |
| Molecular Formula | C42H30O9 |
| Prediction Swissadme | 0.0 |
| Inchi Key | KUTVNHOAKHJJFL-UHFFFAOYSA-N |
| Fcsp3 | 0.1428571428571428 |
| Logs | -2.996 |
| Rotatable Bond Count | 3.0 |
| Logd | 3.972 |
| Synonyms | (+)-alpha-Viniferin, Alpha-viniferin, a-Viniferin, Α-viniferin |
| Compound Name | CID 375682 |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 678.189 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 678.189 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 678.7 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Esol | -8.675149541176472 |
| Inchi | InChI=1S/C42H30O9/c43-22-7-1-19(2-8-22)40-37-28-13-25(46)17-32-35(28)39(42(50-32)21-5-11-24(45)12-6-21)30-15-27(48)18-33-36(30)38(29-14-26(47)16-31(49-40)34(29)37)41(51-33)20-3-9-23(44)10-4-20/h1-18,37-48H |
| Smiles | C1=CC(=CC=C1C2C3C4=C5C(C(OC5=CC(=C4)O)C6=CC=C(C=C6)O)C7=C8C(C(OC8=CC(=C7)O)C9=CC=C(C=C9)O)C1=C3C(=CC(=C1)O)O2)O |
| Nring | 10.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | 2-arylbenzofuran flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Caragana Sinica (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Vitis Vinifera (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all