(R)-Mahanine
PubChem CID: 375151
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (R)-Mahanine, MLS000863643, 3,5-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazol-9-ol, SMR000440720, NSC654285, CHEMBL496633, cid_375151, MEGxp0_002002, SCHEMBL13142229, ACon0_000349, ACon1_001953, BDBM58017, HMS2271C04, DBA36049, FS-7577, NSC-654285, NCI60_018849, BRD-A85009230-001-01-6, 5,8-dimethyl-5-(4-methylpent-3-en-1-yl)-6-oxa-17-azatetracyclo[8.7.0.0^{2,7}.0^{11,16}]heptadeca-1,3,7,9,11,13,15-heptaen-14-ol |
|---|---|
| Topological Polar Surface Area | 45.3 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 26.0 |
| Description | Alkaloid from the leaves of Murraya koenigii (curry leaf tree). (R)-Mahanine is found in herbs and spices. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 581.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q03164, P10636, P51450, Q9F4F7, P02791, P10253, P10520, Q6W5P4, P06746, O75164, Q92830, P17861, P35639, Q9UIF8, P14735, O89049, P84022, P08659, O75496, P17405, Q99700, P43220, Q77YF9, Q9NUW8, Q13148, P37840, O75874, O95398 |
| Iupac Name | 3,5-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazol-9-ol |
| Prediction Hob | 1.0 |
| Class | Indoles and derivatives |
| Target Id | NPT1038, NPT51, NPT60, NPT1416, NPT59, NPT2892, NPT4897 |
| Xlogp | 6.3 |
| Superclass | Organoheterocyclic compounds |
| Subclass | Carbazoles |
| Molecular Formula | C23H25NO2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | DWMBXHWBPZZCTN-UHFFFAOYSA-N |
| Fcsp3 | 0.3043478260869565 |
| Logs | -3.945 |
| Rotatable Bond Count | 3.0 |
| State | Solid |
| Logd | 5.001 |
| Synonyms | Bisisomahanine, Isomahanine, Mahanine |
| Compound Name | (R)-Mahanine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 347.189 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 347.189 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 347.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Esol | -6.1163396 |
| Inchi | InChI=1S/C23H25NO2/c1-14(2)6-5-10-23(4)11-9-18-21-19(12-15(3)22(18)26-23)17-8-7-16(25)13-20(17)24-21/h6-9,11-13,24-25H,5,10H2,1-4H3 |
| Smiles | CC1=CC2=C(C3=C1OC(C=C3)(C)CCC=C(C)C)NC4=C2C=CC(=C4)O |
| Nring | 4.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Carbazoles |
- 1. Outgoing r'ship
FOUND_INto/from Clausena Euchrestifolia (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Murraya Alata (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Murraya Crenulata (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Murraya Elongata (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Murraya Euchrestifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Murraya Exotica (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Murraya Koenigii (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Murraya Kwangsiensis (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Murraya Microphylla (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Murraya Paniculata (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Murraya Siamensis (Plant) Rel Props:Reference: