Curryangine
PubChem CID: 375143
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Curryangine, Currayangine, Curryangin, 3,13,13,17-tetramethyl-21-oxa-12-azahexacyclo[10.7.1.12,17.05,20.06,11.014,19]henicosa-1,3,5(20),6,8,10-hexaene, 25488-37-3, Murrayazoline, (+)-Murrayazoline, Mahanimbidin, NSC654277, (+/-)-Currayangine, CHEMBL1971508, CHEBI:179461, NSC-654277, NCI60_018841, 3,13,13,17-tetramethyl-21-oxa-12-azahexacyclo[10.7.1.1^{2,17}.0^{5,20}.0^{6,11}.0^{14,19}]henicosa-1(20),2,4,6,8,10-hexaene |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 14.2 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)C1CCC3CC4CCC5CC2C1C3C5C4 |
| Np Classifier Class | Carbazole alkaloids |
| Deep Smiles | Cccccccccc6nc9cc%13OCC)CCCC8C6))C%10C)C |
| Heavy Atom Count | 25.0 |
| Classyfire Class | Quinolines and derivatives |
| Scaffold Graph Node Level | C1CCC2C(C1)C1CCC3OC4CCC5CN2C1C3C5C4 |
| Classyfire Subclass | Benzoquinolines |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 587.0 |
| Database Name | hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3,13,13,17-tetramethyl-21-oxa-12-azahexacyclo[10.7.1.12,17.05,20.06,11.014,19]henicosa-1,3,5(20),6,8,10-hexaene |
| Nih Violation | False |
| Class | Quinolines and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 5.2 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Subclass | Benzoquinolines |
| Gsk 4 400 Rule | False |
| Molecular Formula | C23H25NO |
| Scaffold Graph Node Bond Level | c1ccc2c(c1)c1ccc3c4c1n2CC1CCC(CC41)O3 |
| Inchi Key | YPSWCORASQDCJM-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Synonyms | (+)-Murrayazoline, Curryangin, Curryangine, Dihydropyrimidine, 17, Mahanimbidin, Mahanimbidine, Murrayazoline, curryangin |
| Esol Class | Moderately soluble |
| Functional Groups | cOC, cn(c)C |
| Compound Name | Curryangine |
| Kingdom | Organic compounds |
| Exact Mass | 331.194 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 331.194 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 331.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C23H25NO/c1-13-11-15-14-7-5-6-8-18(14)24-20(15)19-16-12-23(4,25-21(13)19)10-9-17(16)22(24,2)3/h5-8,11,16-17H,9-10,12H2,1-4H3 |
| Smiles | CC1=CC2=C3C4=C1OC5(CCC(C4C5)C(N3C6=CC=CC=C62)(C)C)C |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Phenanthridines and derivatives |
| Np Classifier Superclass | Tryptophan alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Murraya Koenigii (Plant) Rel Props:Reference:ISBN:9770972795006