2-Amino-4-hydroxy-3-methylpentanoic acid
PubChem CID: 354197
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-amino-4-hydroxy-3-methylpentanoic acid, 4-Hydroxyisoleucine, (2R,3R,4R)-2-Amino-4-hydroxy-3-methylpentanoic acid, 4-HYDROXY-L-ISOLEUCINE, NSC605134, 1219387-79-7, Quararibea lactone, (2S,3R,4S)-4-hydroxy-L-isoleucine, D-Xylo-form, SCHEMBL52747, CHEBI:172410, 21704-86-9, BCP34295, LMFA01050440, From Quararibea funebris (Llave) plant, NSC-605134, 2-amino-4-hydroxy-3-methylpentanoicacid, EN300-1297327, Leucine, iso- 2(S)-3(R)-4(R)-.gamma.-hydroxy-, L-4- hydroxyl isoleucine, (4S)-4-Hydroxy-L-isoleucine |
|---|---|
| Topological Polar Surface Area | 83.6 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | OSCCDBFHNMXNME-UHFFFAOYSA-N |
| Rotatable Bond Count | 3.0 |
| Synonyms | 2-Amino-4-hydroxy-3-methylpentanoic acid, D-xylo-form, 2-Amino-2,3,5-trideoxy-3-methylpentonic acid, 4-hydroxy isoleucine, 4-Hydroxyisoleucine, From quararibea funebris (llave) plant, Quararibea lactone |
| Heavy Atom Count | 10.0 |
| Compound Name | 2-Amino-4-hydroxy-3-methylpentanoic acid |
| Description | Minor amino acid constituent of Trigonella foenum-graecum (fenugreek) seeds. (2R,3R,4R)-2-Amino-4-hydroxy-3-methylpentanoic acid is found in herbs and spices. |
| Exact Mass | 147.09 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 147.09 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 126.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 147.17 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-4-hydroxy-3-methylpentanoic acid |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C6H13NO3/c1-3(4(2)8)5(7)6(9)10/h3-5,8H,7H2,1-2H3,(H,9,10) |
| Smiles | CC(C(C)O)C(C(=O)O)N |
| Xlogp | -2.8 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C6H13NO3 |
- 1. Outgoing r'ship
FOUND_INto/from Trigonella Foenum-Graecum (Plant) Rel Props:Source_db:fooddb_chem_all