(9-Hydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) acetate
PubChem CID: 3483298
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Prochamazulene, (9-hydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) acetate, NS00051353 |
|---|---|
| Topological Polar Surface Area | 72.8 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 22.0 |
| Description | Constituent of Matricaria chamomilla (German chamomile). Matricin is found in many foods, some of which are german camomile, fats and oils, tea, and herbs and spices. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 590.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (9-hydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) acetate |
| Prediction Hob | 1.0 |
| Class | Lactones |
| Xlogp | 1.0 |
| Superclass | Organoheterocyclic compounds |
| Subclass | Gamma butyrolactones |
| Molecular Formula | C17H22O5 |
| Prediction Swissadme | 1.0 |
| Inchi Key | SYTRJRUSWMMZLV-UHFFFAOYSA-N |
| Fcsp3 | 0.6470588235294118 |
| Logs | -1.918 |
| Rotatable Bond Count | 2.0 |
| State | Solid |
| Logd | 1.209 |
| Synonyms | Matricin, Prochamazulene, 9-Hydroxy-3,6,9-trimethyl-2-oxo-2H,3H,3ah,4H,5H,9H,9ah,9BH-azuleno[4,5-b]furan-4-yl acetic acid |
| Compound Name | (9-Hydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) acetate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 306.147 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 306.147 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 306.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Esol | -2.2311196 |
| Inchi | InChI=1S/C17H22O5/c1-8-7-12(21-10(3)18)13-9(2)16(19)22-15(13)14-11(8)5-6-17(14,4)20/h5-6,9,12-15,20H,7H2,1-4H3 |
| Smiles | CC1C2C(CC(=C3C=CC(C3C2OC1=O)(C)O)C)OC(=O)C |
| Nring | 3.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Gamma butyrolactones |
- 1. Outgoing r'ship
FOUND_INto/from Matricaria Chamomilla (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all