3,4-Bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one
PubChem CID: 345761
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | MLS003171545, NSC659369, 3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one, 2(3H)-Furanone, dihydro-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]-, SCHEMBL13505961, DTXSID20862228, HMS3604C17, (3R,4R)-Dihydro-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]-2(3H)-furanone, (-)-Matairesinol, (8R,8'R)-(-)-Matairesinol, NSC403531, AKOS032948407, NSC-403531, 7471-01-4, SMR001875428, DB-053149, 3,4-bis(4-hydroxy-3-methoxybenzyl)dihydrofuran-2(3h)-one, 3,4-bis[(4-hydroxy-3-methoxy-phenyl)methyl]tetrahydrofuran-2-one |
|---|---|
| Prediction Swissadme | 1.0 |
| Topological Polar Surface Area | 85.2 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | MATGKVZWFZHCLI-UHFFFAOYSA-N |
| Fcsp3 | 0.35 |
| Rotatable Bond Count | 6.0 |
| Synonyms | 4,4'-Dihydroxy-3,3'-dimethoxylignan-9,9'-olide, Dihydro-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]-2(3H)-furanone, 9CI, Dihydro-3,4-divanillyl-2(3H)-furanone, 8CI |
| Heavy Atom Count | 26.0 |
| Compound Name | 3,4-Bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| Description | Matairesinol is a plant lignan. It occurs with secoisolariciresinol in numerous foods such as oil seeds, whole grains, vegetables, and fruits. |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 358.142 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 358.142 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 469.0 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 358.4 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Prediction Hob | 1.0 |
| Esol | -4.061356461538462 |
| Inchi | InChI=1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3 |
| Smiles | COC1=C(C=CC(=C1)CC2COC(=O)C2CC3=CC(=C(C=C3)O)OC)O |
| Xlogp | 3.3 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C20H22O6 |
- 1. Outgoing r'ship
FOUND_INto/from Arctium Lappa (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Daphne Genkwa (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Hippophae Rhamnoides (Plant) Rel Props:Source_db:cmaup_ingredients