L-L-Homoglutathione
PubChem CID: 3375152
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | L-L-Homoglutathione, 2-amino-5-[[1-(2-carboxyethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid, H-GLU(CYS-BETA-ALA-OH)-OH, SCHEMBL4653672, CHEBI:187463, 2-amino-5-[[1-(2-carboxyethylamino)-1-oxo-3-sulanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| Topological Polar Surface Area | 160.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | HKBNQXMLSMKLJV-UHFFFAOYSA-N |
| Rotatable Bond Count | 10.0 |
| Synonyms | g-Glutamylcysteinyl-b-alanine, N-[1-[(2-Carboxyethyl)carbamoyl]-2-mercaptoethyl]glutamine, 8CI |
| Heavy Atom Count | 21.0 |
| Compound Name | L-L-Homoglutathione |
| Description | L-l-homoglutathione is a member of the class of compounds known as hybrid peptides. Hybrid peptides are compounds containing at least two different types of amino acids (alpha, beta, gamma, delta) linked to each other through a peptide bond. L-l-homoglutathione is practically insoluble (in water) and a moderately acidic compound (based on its pKa). L-l-homoglutathione can be found in pulses, which makes L-l-homoglutathione a potential biomarker for the consumption of this food product. |
| Exact Mass | 321.099 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 321.099 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 403.0 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 321.35 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-5-[[1-(2-carboxyethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C11H19N3O6S/c12-6(11(19)20)1-2-8(15)14-7(5-21)10(18)13-4-3-9(16)17/h6-7,21H,1-5,12H2,(H,13,18)(H,14,15)(H,16,17)(H,19,20) |
| Smiles | C(CC(=O)NC(CS)C(=O)NCCC(=O)O)C(C(=O)O)N |
| Xlogp | -4.6 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C11H19N3O6S |
- 1. Outgoing r'ship
FOUND_INto/from Vigna Radiata (Plant) Rel Props:Source_db:fooddb_chem_all