Acetylacetone
PubChem CID: 31261
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Acetylacetone, 2,4-Pentanedione, Pentane-2,4-dione, 123-54-6, Acetoacetone, ACAC, 2,4-Dioxopentane, Diacetylmethane, 2,4-Pentadione, ACETYL ACETONE, Pentanedione, Pentan-2,4-dione, Pentanedione-2,4, Acetyl 2-propanone, Acetone, acetyl-, Hacac, 2-Propanone, acetyl-, 2,4-Pentandione, NSC 5575, acetylaceton, CCRIS 3466, acetyl-acetone, HSDB 2064, EINECS 204-634-0, 4-Hydroxy-3-penten-2-one, UNII-46R950BP4J, BRN 0741937, CH3-CO-CH2-CO-CH3, DTXSID4021979, CHEBI:14750, AI3-02266, 46R950BP4J, ACETYLACETONE ENOL, CH3COCH2COCH3, NSC-5575, MFCD00008787, DTXCID601979, EC 204-634-0, 4-01-00-03662 (Beilstein Handbook Reference), 14024-62-5, UN2310, Acetylaceetone, 81235-32-7, pentane-2, pentan-2, acetylacetone (2,4-pentanedione), 2,4 pentanedione, 2.4-pentanedione, pentane2,4-dione, Acetyl-2-Propanone, Acetyl-2-propaneone, 2,4-pentane-dione, ACETYLACETONE [MI], 1-methylbutane-1,3-dione, SCHEMBL1608, NCIOpen2_000702, Pentane-2,4-dione [UN2310] [Flammable liquid], ACETYL ACETONE [HSDB], CHEMBL191625, WLN: 1V1V1, Acetylacetone, Pentane-2,4-dione, BDBM22766, NSC5575, Acetylacetone, analytical standard, BCP31333, STR00020, Tox21_200414, LMFA12000075, AKOS000118994, FP35056, UN 2310, Acetylacetone, ReagentPlus(R), >=99%, NCGC00248599-01, NCGC00257968-01, BP-30252, CAS-123-54-6, PD193123, Acetylacetone, JIS special grade, >=99%, DB-020012, DB-318551, DS-002710, NS00007112, P0052, EN300-19143, Q413447, Pentane-2,4-dione [UN2310] [Flammable liquid], F1908-0168, InChI=1/C5H8O2/c1-4(6)3-5(2)7/h3H2,1-2H, Acetylacetone, produced by Wacker Chemie AG, Burghausen, Germany, >=99.5% (GC) |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 34.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Oxygenated hydrocarbons |
| Deep Smiles | CC=O)CC=O)C |
| Heavy Atom Count | 7.0 |
| Classyfire Class | Organooxygen compounds |
| Description | Isolated from ethereal oil of Pinus sylvestris (Scotch pine). 2,4-Pentanedione is found in papaya. |
| Classyfire Subclass | Carbonyl compounds |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 82.3 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | O00748, P23141, P12337, P22303, P06276, P29477, P15917, P14780, P03956, P22894, P09917, P08254, P08253, O42713 |
| Iupac Name | pentane-2,4-dione |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Carbonyl compounds |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | 0.4 |
| Superclass | Organooxygen compounds |
| Is Pains | False |
| Subclass | 1,3-dicarbonyl compounds |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H8O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | YRKCREAYFQTBPV-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.6 |
| Logs | 0.14 |
| Rotatable Bond Count | 2.0 |
| State | Liquid |
| Logd | -1.711 |
| Synonyms | 2,4-Dioxopentane, 2,4-Pentadione, 2,4-Pentandione, 4-Hydroxy-3-penten-2-one, ACAC, Acetoacetone, Acetyl 2-propanone, Acetyl acetone, Acetyl-2-propanone, Acetyl-acetone, Acetylacetone, Benzil-related compound, 44, CH3-CO-CH2-CO-CH3, CH3COCH2COCH3, Diacetylmethane, Hacac, Pentan-2,4-dione, Pentane-2,4-dione, Pentanedione, Pentanedione-2,4, Indium-111-acetylacetone, 2,4-Pentanedione, 2,4-pentanedione |
| Substituent Name | 1,3-diketone, Ketone, Hydrocarbon derivative, Aliphatic acyclic compound |
| Esol Class | Very soluble |
| Functional Groups | CC(C)=O |
| Compound Name | Acetylacetone |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 100.052 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 100.052 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 100.12 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -0.5807253999999998 |
| Inchi | InChI=1S/C5H8O2/c1-4(6)3-5(2)7/h3H2,1-2H3 |
| Smiles | CC(=O)CC(=O)C |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Beta-diketones |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Alcea Rosea (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Aloe Africana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Aloe Barbadensis (Plant) Rel Props:Source_db:npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Aloe Ferox (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Aloe Spicata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Aloe Vera (Plant) Rel Props:Source_db:cmaup_ingredients - 7. Outgoing r'ship
FOUND_INto/from Alpinia Blepharocalyx (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Araiostegiella Perdurans (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Balanops Australiana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Carica Papaya (Plant) Rel Props:Source_db:fooddb_chem_all - 11. Outgoing r'ship
FOUND_INto/from Eucalyptus Jensenii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Euonymus Tingens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Euphorbia Cornigera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Hylocomium Splendens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Kokoona Reflexa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Maesa Ramentacea (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Millettia Laurentii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Monodora Tenuifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Ocimum Tenuiflorum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Pinus Strobus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 21. Outgoing r'ship
FOUND_INto/from Pinus Sylvestris (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 22. Outgoing r'ship
FOUND_INto/from Pluchea Odorata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 23. Outgoing r'ship
FOUND_INto/from Salacia Lehmbachii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 24. Outgoing r'ship
FOUND_INto/from Salvia Yosgadensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 25. Outgoing r'ship
FOUND_INto/from Sideritis Brevibracteata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 26. Outgoing r'ship
FOUND_INto/from Sideroxylon Cubense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 27. Outgoing r'ship
FOUND_INto/from Viguiera Decurrens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 28. Outgoing r'ship
FOUND_INto/from Viscum Album (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1996.9701029