2,6-Diaminopurine
PubChem CID: 30976
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2,6-Diaminopurine, 1904-98-9, 7H-purine-2,6-diamine, 2-Aminoadenine, 9H-Purine-2,6-diamine, 1H-Purine-2,6-diamine, 26-diaminopurine, Purine, 2,6-diamino-, 2,6-diamino-9h-purine, Purine-2,6-diyldiamine, NSC 743, SQ 21065, CCRIS 923, Group4_Adenines, X 79, 2,6-Diamino-purin-9-yl, EINECS 217-605-2, 49P95BAU4Z, CHEBI:40235, AI3-25010, NSC-743, 2,6-Diaminopurine, 98%, DIAMINOPURINE, 2,6-, CHEMBL388596, NSC743, DTXSID0062052, 2,6-DIAMINOPURINE [MI], 133762-79-5, 6AP, purine-2,6-diamine, MFCD00213668, UNII-49P95BAU4Z, CCRIS 3903, 2-6-Diaminopurine, Purine,6-diamino-, MFCD00071537, Purine, 2, 6-diamino-, Oprea1_670021, SCHEMBL24052, 9H-Purine-2,6-diamine #, MLS001066366, DTXCID6035998, SCHEMBL16513167, (2-amino-7H-purin-6-yl)-amine, HMS2267N10, ALBB-023319, BCP30955, BDBM50208879, MFCD00047146, AKOS003368184, AKOS015896933, AKOS028109333, 9H-Purine-2,6-diamine0.5M H2SO4, AC-8693, CS-W014347, FD04050, GS-3048, HY-W013631, 9H-Purine-2,6-diamine, 2-Aminoadenine, BP-13206, SMR000112503, SY036886, TS-00060, DB-015922, D1625, NS00026227, C22439, EN300-101012, AC-907/34116038, Q4596802, Z1255486094 |
|---|---|
| Topological Polar Surface Area | 107.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | MSSXOMSJDRHRMC-UHFFFAOYSA-N |
| Rotatable Bond Count | 0.0 |
| Synonyms | 1H-Purine-2,6-diamine, 2-Aminoadenine, 9H-Purine-2,6-diamine, Purine, 2,6-diamino-, 2,6-Diaminopurine sulfate |
| Heavy Atom Count | 11.0 |
| Compound Name | 2,6-Diaminopurine |
| Kingdom | Organic compounds |
| Description | 2,6-diaminopurine, also known as 2-aminoadenine, is a member of the class of compounds known as 6-aminopurines. 6-aminopurines are purines that carry an amino group at position 6. Purine is a bicyclic aromatic compound made up of a pyrimidine ring fused to an imidazole ring. 2,6-diaminopurine is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). 2,6-diaminopurine can be synthesized from adenine. 2,6-diaminopurine can also be synthesized into reversine. 2,6-diaminopurine can be found in broad bean, which makes 2,6-diaminopurine a potential biomarker for the consumption of this food product. 2,6-diaminopurine is a compound used to treat leukemia.[1] In August 2011, a report, based on NASA studies with meteorites found on Earth, was published suggesting 2,6-diaminopurine and related organic molecules, including the DNA and RNA components adenine and guanine, may have been formed extraterrestrially in outer space . |
| Exact Mass | 150.065 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 150.065 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 150.0 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 150.14 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 7H-purine-2,6-diamine |
| Total Atom Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Imidazopyrimidines |
| Inchi | InChI=1S/C5H6N6/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H5,6,7,8,9,10,11) |
| Smiles | C1=NC2=NC(=NC(=C2N1)N)N |
| Xlogp | -0.9 |
| Superclass | Organoheterocyclic compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Purines and purine derivatives |
| Taxonomy Direct Parent | 6-aminopurines |
| Molecular Formula | C5H6N6 |
- 1. Outgoing r'ship
FOUND_INto/from Vicia Faba (Plant) Rel Props:Source_db:fooddb_chem_all