Piperolactam A
PubChem CID: 3081016
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Piperolactam A, Aristolactam FI, 112501-42-5, Aristolactam F1, Dibenz[cd,f]indol-4(5H)-one, 1-hydroxy-2-methoxy-, 15-hydroxy-14-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one, 1-Hydroxy-2-methoxydibenz(cd,f)indol-4(5H)-one, 1-Hydroxy-2-methoxydibenz[cd,f]indol-4(5H)-one, Dibenz(cd,f)indol-4(5H)-one, 1-hydroxy-2-methoxy-, 1-Hydroxy-2-methoxydibenz[cd,f]indol-4(5H)-one, Aristololactam FI, 1-Hydroxy-2-methoxy-Dibenz(cd,f)indol-4(5H)-one, 1-Hydroxy-2-methoxy-Dibenz[cd,f]indol-4(5H)-one, CXQ3T84KLC, CHEMBL387864, DTXSID90150083, CHEBI:174488, HY-N2894, MEA50142, AKOS028108734, NCGC00385457-01, FS-10150, CS-0023479, F92851, 1-Hydroxy-2-methoxydibenzo[cd,f]indol-4(5H)-one, 1-Hydroxy-2-methoxydibenz[cd,f]indol-4(5H)-one, 9CI, B0005-189391, NCGC00385457-01_C16H11NO3_1-Hydroxy-2-methoxydibenzo[cd,f]indol-4(5H)-one, 14-Methoxy-15-oxidanyl-10-azatetracyclo(7.6.1.02,7.012,16)hexadeca-1(15),2,4,6,8,12(16),13-heptaen-11-one, 15-HYDROXY-14-METHOXY-10-AZATETRACYCLO[7.6.1.0(2),?.0(1)(2),(1)?]HEXADECA-1(16),2(7),3,5,8,12,14-HEPTAEN-11-ONE, 15-hydroxy-14-methoxy-10-azatetracyclo[7.6.1.0^{2,7}.0^{12,16}]hexadeca-1(15),2,4,6,8,12(16),13-heptaen-11-one |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 58.6 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC2CC3CCCCC3C3CCCC1C23 |
| Np Classifier Class | Aporphine alkaloids |
| Deep Smiles | COcccC=O)Ncc5cc9O))cccccc6c%10 |
| Heavy Atom Count | 20.0 |
| Classyfire Class | Aristolactams |
| Description | Alkaloid from roots of Piper longum (long pepper). |
| Scaffold Graph Node Level | OC1NC2CC3CCCCC3C3CCCC1C23 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 413.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | n.a. |
| Iupac Name | 15-hydroxy-14-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Phenanthrenes and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 3.0 |
| Superclass | Benzenoids |
| Is Pains | False |
| Subclass | Phenanthrols |
| Gsk 4 400 Rule | True |
| Molecular Formula | C16H11NO3 |
| Scaffold Graph Node Bond Level | O=C1Nc2cc3ccccc3c3cccc1c23 |
| Prediction Swissadme | 0.0 |
| Inchi Key | KBGNBPGXVKPRQI-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.0625 |
| Logs | -5.64 |
| Rotatable Bond Count | 1.0 |
| State | Solid |
| Logd | 2.917 |
| Synonyms | 1-Hydroxy-2-methoxy-dibenz(cd,F)indol-4(5H)-one, 1-Hydroxy-2-methoxy-dibenz[cd,F]indol-4(5H)-one, 1-Hydroxy-2-methoxydibenz(cd,f)indol-4(5H)-one, 1-Hydroxy-2-methoxydibenz[cd,f]indol-4(5H)-one, 9CI, Aristolactam F1, Dibenz(cd,f)indol-4(5H)-one, 1-hydroxy-2-methoxy-, Dibenz[cd,f]indol-4(5H)-one, 1-hydroxy-2-methoxy-, Piperolactam A, 1-Hydroxy-2-methoxy-dibenz(CD,F)indol-4(5H)-one, 1-Hydroxy-2-methoxy-dibenz[CD,F]indol-4(5H)-one, 1-Hydroxy-2-methoxydibenz(CD,F)indol-4(5H)-one, 1-Hydroxy-2-methoxydibenz[CD,F]indol-4(5H)-one, 9ci, Piperolactam a, piperolactam a |
| Substituent Name | Phenanthrol, 1-naphthol, Naphthalene, Methoxyphenol, Isoindole or derivatives, Indole or derivatives, Anisole, Alkyl aryl ether, Cyclic carboximidic acid, Azacycle, Organoheterocyclic compound, Organic 1,3-dipolar compound, Propargyl-type 1,3-dipolar organic compound, Ether, Hydrocarbon derivative, Aromatic alcohol, Organooxygen compound, Organonitrogen compound, Aromatic heteropolycyclic compound |
| Esol Class | Soluble |
| Functional Groups | cNC(c)=O, cO, cOC |
| Compound Name | Piperolactam A |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 265.074 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 265.074 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 265.26 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -4.2298615999999996 |
| Inchi | InChI=1S/C16H11NO3/c1-20-12-7-10-13-11(17-16(10)19)6-8-4-2-3-5-9(8)14(13)15(12)18/h2-7,18H,1H3,(H,17,19) |
| Smiles | COC1=C(C2=C3C(=C1)C(=O)NC3=CC4=CC=CC=C42)O |
| Nring | 4.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Aristolactams |
| Np Classifier Superclass | Tyrosine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Aconitum Vilmorini (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Artemisia Coerulescens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Asplenium Adiantum-Nigrum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Distemonanthus Benthamianus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Fissistigma Balansae (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Fissistigma Oldhamii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Houttuynia Cordata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Mortonia Palmeri (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Piper Attenuatum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Piper Bantamense (Plant) Rel Props:Reference:ISBN:9788172362461 - 11. Outgoing r'ship
FOUND_INto/from Piper Boehmeriaefolium (Plant) Rel Props:Source_db:npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Piper Hamiltonii (Plant) Rel Props:Source_db:npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Piper Longum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Piper Taiwanense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all