(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal
PubChem CID: 3037556
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | aldehydo-D-galactose, (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal, 26566-61-0, D(+)-Galactose, Galactose [USAN], aldehydo-D-galacto-hexose, X2RN3Q8DNE, DTXSID0023088, dl-Galactose, Galactose, D-, D-aGalactose, D-Galaktose, D-?Galactose, Galactose,(S), D-Galactose (Standard), AI3-09083, GALACTOSE [VANDF], D-GALACTOSE [MI], GALACTOSE [WHO-DD], SCHEMBL18313, D-galactose (open ring form), D-Galactose non-animal origin, CHEBI:17118, HY-N0210R, D-(+)-Galactose, >=98%, D-(+)-Galactose, >=99%, HY-N0210, Tox21_111672, AKOS015924582, CS-6382, DB11735, MG06473, CAS-59-23-4, D-(+)-Galactose, puriss., 98.0%, BP-21016, DB-053345, NS00100733, C01582, EN300-103359, D-(+)-Galactose, for microbiology, >=99.0%, D-(+)-Galactose, Vetec(TM) reagent grade, >=98%, Q27102217, rel-(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal, DD3EA070-54A6-4EA7-B99B-A6E975FDD204, Galactose, European Pharmacopoeia (EP) Reference Standard, D-(+)-Galactose, BioUltra, >=99.5% (sum of enantiomers, HPLC), D-(+)-Galactose, meets analytical specification of Ph.??Eur., BP, D-(+)-Galactose, BioXtra, pH 5.0-7.0 (20 C, 1 M in H2O), >=99%, Galactose, Pharmaceutical Secondary Standard, Certified Reference Material, D-(+)-Galactose, powder, anhydrous, BioReagent, suitable for cell culture, suitable for insect cell culture |
|---|---|
| Topological Polar Surface Area | 118.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Heavy Atom Count | 12.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 138.0 |
| Database Name | cmaup_ingredients;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal |
| Nih Violation | True |
| Prediction Hob | 1.0 |
| Xlogp | -2.9 |
| Is Pains | False |
| Molecular Formula | C6H12O6 |
| Prediction Swissadme | 0.0 |
| Inchi Key | GZCGUPFRVQAUEE-KCDKBNATSA-N |
| Fcsp3 | 0.8333333333333334 |
| Logs | 0.129 |
| Rotatable Bond Count | 5.0 |
| Logd | -2.4 |
| Compound Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 180.063 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 180.063 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 180.16 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 1.2252328000000001 |
| Inchi | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6-/m0/s1 |
| Smiles | C([C@H]([C@@H]([C@@H]([C@H](C=O)O)O)O)O)O |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Adonis Mongolica (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Althaea Officinalis (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Aniba Duckei (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Asarum Caulescens (Plant) Rel Props:Source_db:cmaup_ingredients - 5. Outgoing r'ship
FOUND_INto/from Calypogeia Integristipula (Plant) Rel Props:Source_db:cmaup_ingredients - 6. Outgoing r'ship
FOUND_INto/from Conyza Bonariensis (Plant) Rel Props:Source_db:cmaup_ingredients - 7. Outgoing r'ship
FOUND_INto/from Desmodium Oxyphyllum (Plant) Rel Props:Source_db:cmaup_ingredients - 8. Outgoing r'ship
FOUND_INto/from Dianthus Caryophyllus (Plant) Rel Props:Source_db:cmaup_ingredients - 9. Outgoing r'ship
FOUND_INto/from Dictamnus Gymnostylis (Plant) Rel Props:Source_db:cmaup_ingredients - 10. Outgoing r'ship
FOUND_INto/from Eupatorium Altissimum (Plant) Rel Props:Source_db:cmaup_ingredients - 11. Outgoing r'ship
FOUND_INto/from Gentiana Dahurica (Plant) Rel Props:Source_db:cmaup_ingredients - 12. Outgoing r'ship
FOUND_INto/from Larix Laricina (Plant) Rel Props:Source_db:cmaup_ingredients - 13. Outgoing r'ship
FOUND_INto/from Nama Johnstonii (Plant) Rel Props:Source_db:cmaup_ingredients - 14. Outgoing r'ship
FOUND_INto/from Putterlickia Verrucosa (Plant) Rel Props:Source_db:cmaup_ingredients - 15. Outgoing r'ship
FOUND_INto/from Salvia Splendens (Plant) Rel Props:Source_db:cmaup_ingredients - 16. Outgoing r'ship
FOUND_INto/from Sophora Davidii (Plant) Rel Props:Source_db:cmaup_ingredients - 17. Outgoing r'ship
FOUND_INto/from Vernonia Condensata (Plant) Rel Props:Source_db:cmaup_ingredients - 18. Outgoing r'ship
FOUND_INto/from Virola Sebifera (Plant) Rel Props:Source_db:cmaup_ingredients - 19. Outgoing r'ship
FOUND_INto/from Withania Coagulans (Plant) Rel Props:Source_db:cmaup_ingredients