2-Ethyl-3-Methylpyrazine
PubChem CID: 27457
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-ETHYL-3-METHYLPYRAZINE, 15707-23-0, Pyrazine, 2-ethyl-3-methyl-, 2-Methyl-3-ethylpyrazine, 3-Ethyl-2-methylpyrazine, 2-Ethyl-3-methyl pyrazine, FEMA No. 3155, 2-Ethyl-3-methylpyrazine, 9CI, BRN 0956775, 2-ethyl-3-methyl-pyrazine, EINECS 239-799-8, UNII-9GF35MK66U, 9GF35MK66U, DTXSID4047464, 2-Methyl-3-ethyl pyrazine, Pyrazine, 3-ethyl-2-methyl, DTXCID2027464, FEMA 3155, 5-23-05-00418 (Beilstein Handbook Reference), Pyrazine, ethylmethyl-, 2-ETHYL-3-METHYLPYRAZINE [FCC], 2-ETHYL-3-METHYL-1,4-PYRAZINE, 2-ETHYL-3-METHYLPYRAZINE [FHFI], MFCD00006150, 2-Methyl-3-ethyl-pyrazine, SCHEMBL108460, CHEMBL3187840, CHEBI:193620, Tox21_302613, AKOS015842908, CS-W013548, NCGC00256746-01, AC-16592, BS-15466, CAS-15707-23-0, DB-021037, E0361, NS00012435, 2-Ethyl-3-methylpyrazine, >=98%, FCC, FG, D90495, EN300-2010184, Q17239258, 2-Ethyl-3-methylpyrazine, analytical reference material, 239-799-8 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 25.8 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Pyrazine and Piperazine alkaloids |
| Deep Smiles | CCcnccnc6C |
| Heavy Atom Count | 9.0 |
| Classyfire Class | Diazines |
| Description | Flavouring compound [Flavornet] |
| Scaffold Graph Node Level | C1CNCCN1 |
| Classyfire Subclass | Pyrazines |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 83.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P10275 |
| Iupac Name | 2-ethyl-3-methylpyrazine |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Diazines |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 1.1 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Subclass | Pyrazines |
| Gsk 4 400 Rule | True |
| Molecular Formula | C7H10N2 |
| Scaffold Graph Node Bond Level | c1cnccn1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | LNIMMWYNSBZESE-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.4285714285714285 |
| Logs | 0.528 |
| Rotatable Bond Count | 1.0 |
| Logd | 1.052 |
| Synonyms | 2-ETHYL-3-METHYL PYRAZINE, 2-Ethyl-3-methyl-pyrazine, 2-Methyl-3-ethylpyrazine, 3-Ethyl-2-methylpyrazine, FEMA 3155, Pyrazine, 2-ethyl-3-methyl-, Pyrazine, 3-ethyl-2-methyl, 2-ETHYL-3-methyl pyrazine, 2-ethyl-3-methyl-pyrazine, 2-ethyl-3-methylpyrazine, pyrazine, 2-ethyl-3-methyl- |
| Substituent Name | Pyrazine, Heteroaromatic compound, Azacycle, Hydrocarbon derivative, Organonitrogen compound, Aromatic heteromonocyclic compound |
| Esol Class | Very soluble |
| Functional Groups | cnc |
| Compound Name | 2-Ethyl-3-Methylpyrazine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 122.084 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 122.084 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 122.17 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -1.698893533333333 |
| Inchi | InChI=1S/C7H10N2/c1-3-7-6(2)8-4-5-9-7/h4-5H,3H2,1-2H3 |
| Smiles | CCC1=NC=CN=C1C |
| Nring | 1.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids, Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Pyrazines |
| Np Classifier Superclass | Tetramate alkaloids, Peptide alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Arachis Hypogaea (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.961039 - 2. Outgoing r'ship
FOUND_INto/from Argyranthemum Frutescens (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Baeckea Frutescens (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Capsicum Frutescens (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Chrysopogon Zizanioides (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2005.9699005 - 6. Outgoing r'ship
FOUND_INto/from Coffea Arabica (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3517 - 7. Outgoing r'ship
FOUND_INto/from Coffea Canephora (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3517 - 8. Outgoing r'ship
FOUND_INto/from Dalbergia Frutescens (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Ichnocarpus Frutescens (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Iva Frutescens (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Oreocnide Frutescens (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Perilla Frutescens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Perilla Ocymoides (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Piper Nigrum (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2006.9699369 - 15. Outgoing r'ship
FOUND_INto/from Scaevola Frutescens (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Sutherlandia Frutescens (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Trigonella Foenum-Graecum (Plant) Rel Props:Source_db:fooddb_chem_all - 18. Outgoing r'ship
FOUND_INto/from Triticum Aestivum (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2007.9699245