2-Ethyl-6-methylpyrazine
PubChem CID: 26332
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-ETHYL-6-METHYLPYRAZINE, 13925-03-6, Pyrazine, 2-ethyl-6-methyl-, 2-Methyl-6-ethylpyrazine, 2,6-Methylethylpyrazine, UNII-A9BL9OKQ7T, A9BL9OKQ7T, Pyrazine, 6-ethyl-2-methyl, EINECS 237-692-0, 2-ethyl-6-methyl-pyrazine, FEMA NO. 3919, FEMA 3919, 6-METHYL-2-ETHYLPYRAZINE, DTXSID60160977, 2-ETHYL-6-METHYLPYRAZINE [FHFI], PYRAZINE,2-ETHYL-6-METHYL-, MFCD00055035, SCHEMBL105987, CHEMBL4522941, DTXCID0083468, CHEBI:193621, NAA92503, AKOS006283739, DS-20136, DB-116794, CS-0161293, NS00021636, D84033, EN300-300011, Q27273802, 237-692-0 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 25.8 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Pyrazine and Piperazine alkaloids |
| Deep Smiles | CCccnccn6)C |
| Heavy Atom Count | 9.0 |
| Classyfire Class | Diazines |
| Description | 2-ethyl-6-methylpyrazine is a member of the class of compounds known as pyrazines. Pyrazines are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. 2-ethyl-6-methylpyrazine is soluble (in water) and a moderately basic compound (based on its pKa). 2-ethyl-6-methylpyrazine is a potato and roasted tasting compound and can be found in a number of food items such as tea, cereals and cereal products, nuts, and coffee and coffee products, which makes 2-ethyl-6-methylpyrazine a potential biomarker for the consumption of these food products. |
| Scaffold Graph Node Level | C1CNCCN1 |
| Classyfire Subclass | Pyrazines |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 83.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-ethyl-6-methylpyrazine |
| Prediction Hob | 1.0 |
| Class | Diazines |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 1.0 |
| Superclass | Organoheterocyclic compounds |
| Subclass | Pyrazines |
| Gsk 4 400 Rule | True |
| Molecular Formula | C7H10N2 |
| Scaffold Graph Node Bond Level | c1cnccn1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | RAFHQTNQEZECFL-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.4285714285714285 |
| Logs | 0.526 |
| Rotatable Bond Count | 1.0 |
| Logd | 1.103 |
| Synonyms | 2,6-Methylethylpyrazine, 2-Ethyl-6-methyl-pyrazine, 2-Methyl-6-ethylpyrazine, FEMA 3919, Pyrazine, 6-ethyl-2-methyl, 2-ethyl-6-methylpyrazine, pyrazine 2-ethyl-6-methyl |
| Esol Class | Very soluble |
| Functional Groups | cnc |
| Compound Name | 2-Ethyl-6-methylpyrazine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 122.084 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 122.084 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 122.17 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -1.6673935333333332 |
| Inchi | InChI=1S/C7H10N2/c1-3-7-5-8-4-6(2)9-7/h4-5H,3H2,1-2H3 |
| Smiles | CCC1=NC(=CN=C1)C |
| Nring | 1.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids, Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Pyrazines |
| Np Classifier Superclass | Tetramate alkaloids, Peptide alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Chrysopogon Zizanioides (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2005.9699005 - 3. Outgoing r'ship
FOUND_INto/from Glycyrrhiza Glabra (Plant) Rel Props:Reference:ISBN:9780896038776 - 4. Outgoing r'ship
FOUND_INto/from Perilla Frutescens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Piper Nigrum (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2006.9699369