(2R,4R)-4-hydroxypiperidine-2-carboxylic acid
PubChem CID: 261165
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (2R,4R)-4-hydroxypiperidine-2-carboxylic acid, 189385-64-6, 1622-20-4, trans-4-hydroxypipecolic acid, 2-Piperidinecarboxylicacid,4-hydroxy-,(2R,4R)-(9CI), NSC93088, trans-4-Hydroxypiperidine-2-carboxylic acid, PIPECOLIC ACID, 4-HYDROXY, CHEMBL507830, SCHEMBL1512968, MFCD18834649, NSC-93088, AKOS006351334, EN300-7068985, EN300-7201892, A810352, rac-(2R,4R)-4-hydroxypiperidine-2-carboxylic acid |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 69.6 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Aminoacids |
| Deep Smiles | O[C@@H]CCN[C@H]C6)C=O)O |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Scaffold Graph Node Level | C1CCNCC1 |
| Classyfire Subclass | Amino acids, peptides, and analogues |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 137.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (2R,4R)-4-hydroxypiperidine-2-carboxylic acid |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | -3.0 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C6H11NO3 |
| Scaffold Graph Node Bond Level | C1CCNCC1 |
| Inchi Key | KRHNXNZBLHHEIU-RFZPGFLSSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | trans-4-hydroxypipecolic acid |
| Esol Class | Highly soluble |
| Functional Groups | CC(=O)O, CNC, CO |
| Compound Name | (2R,4R)-4-hydroxypiperidine-2-carboxylic acid |
| Exact Mass | 145.074 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 145.074 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 145.16 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C6H11NO3/c8-4-1-2-7-5(3-4)6(9)10/h4-5,7-8H,1-3H2,(H,9,10)/t4-,5-/m1/s1 |
| Smiles | C1CN[C@H](C[C@@H]1O)C(=O)O |
| Np Classifier Biosynthetic Pathway | Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Small peptides |
- 1. Outgoing r'ship
FOUND_INto/from Acacia Pubescens (Plant) Rel Props:Reference:ISBN:9788185042084