DL-Leucyl-DL-phenylalanine
PubChem CID: 259325
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | DL-Leucyl-DL-phenylalanine, 56217-82-4, DL-Leu-DL-Phe, leucylphenylalanine, 2-(2-amino-4-methylpentanamido)-3-phenylpropanoic acid, H-DL-Leu-DL-Phe-OH, 2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoic acid, 3303-30-8, Lf, NSC89191, Leu-Phe-OH, MFCD00037258, SCHEMBL2185269, DTXSID60952899, NSC-89191, NSC524454, AKOS009158552, NSC-524454, AS-69592, FL108099, DB-326242, DS-003738, HY-139440, CS-0201227, L0038, T72622, DL-Leucyl-DL-phenylalanine (H-DL-Leu-DL-Phe-OH), 2-[(2-Amino-4-methyl-pentanoyl)amino]-3-phenyl-propanoic acid |
|---|---|
| Topological Polar Surface Area | 92.4 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | KFKWRHQBZQICHA-UHFFFAOYSA-N |
| Rotatable Bond Count | 7.0 |
| Heavy Atom Count | 20.0 |
| Compound Name | DL-Leucyl-DL-phenylalanine |
| Description | Leucyl-phenylalanine, also known as (2s,3s)-(2-2h,3-2h)-leucine-(S)-phenylalanine or leu-phe, is a member of the class of compounds known as dipeptides. Dipeptides are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Leucyl-phenylalanine is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Leucyl-phenylalanine can be found primarily in blood, feces, and urine. |
| Exact Mass | 278.163 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 278.163 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 325.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 278.35 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoic acid |
| Total Atom Stereocenter Count | 2.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C15H22N2O3/c1-10(2)8-12(16)14(18)17-13(15(19)20)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9,16H2,1-2H3,(H,17,18)(H,19,20) |
| Smiles | CC(C)CC(C(=O)NC(CC1=CC=CC=C1)C(=O)O)N |
| Xlogp | -1.1 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C15H22N2O3 |
- 1. Outgoing r'ship
FOUND_INto/from Petroselinum Crispum (Plant) Rel Props:Source_db:fooddb_chem_all