Acetylcaranine
PubChem CID: 258956
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Belamarine, ACETYLCARANINE, 14383-07-4, CHEBI:2415, 1alpha-acetoxy-9,10-methylenedioxygalanth-3(12)-ene, Galanthan-1-ol, 3,12-didehydro-9,10-(methylenebis(oxy))-, acetate, Caranine, acetyl-, (1R,12bS,12cS)-1,2,4,5,12b,12c-hexahydro-7H-[1,3]dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridin-1-yl acetate, [(1S,18R,19S)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9,15-tetraen-18-yl] acetate, CHEMBL522145, DTXSID20932117, NSC88420, NSC-88420, C08513, Q27105658, 2,4,5,7,12b,12c-Hexahydro-1H,10H-[1,3]dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridin-1-yl acetate |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 48.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CC2CC3CC4CCC5CCCC(C3CC2C1)C54 |
| Np Classifier Class | Amarylidaceae alkaloids, Indolizidine alkaloids |
| Deep Smiles | CC=O)O[C@@H]CC=C[C@@H][C@@H]6cccOCOc5cc9CN%13CC%16 |
| Heavy Atom Count | 23.0 |
| Classyfire Class | Amaryllidaceae alkaloids |
| Scaffold Graph Node Level | C1CC2CCN3CC4CC5OCOC5CC4C(C1)C23 |
| Classyfire Subclass | Lycorine-type amaryllidaceae alkaloids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 547.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | [(1S,18R,19S)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9,15-tetraen-18-yl] acetate |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 1.7 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C18H19NO4 |
| Scaffold Graph Node Bond Level | C1=C2CCN3Cc4cc5c(cc4C(CC1)C23)OCO5 |
| Prediction Swissadme | 1.0 |
| Inchi Key | SEWQEQSXDGJDGG-ZTFGCOKTSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.5 |
| Logs | -2.994 |
| Rotatable Bond Count | 2.0 |
| Logd | 2.449 |
| Synonyms | acetylcaranine |
| Esol Class | Soluble |
| Functional Groups | CC(=O)OC, CC=C(C)C, CN(C)C, c1cOCO1 |
| Compound Name | Acetylcaranine |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 313.131 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 313.131 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 313.3 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -2.9021816782608694 |
| Inchi | InChI=1S/C18H19NO4/c1-10(20)23-14-3-2-11-4-5-19-8-12-6-15-16(22-9-21-15)7-13(12)17(14)18(11)19/h2,6-7,14,17-18H,3-5,8-9H2,1H3/t14-,17-,18-/m1/s1 |
| Smiles | CC(=O)O[C@@H]1CC=C2CCN3[C@H]2[C@@H]1C4=CC5=C(C=C4C3)OCO5 |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Lysine alkaloids, Tyrosine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Amaryllis Belladonna (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Amaryllis Radiata (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Atropa Belladonna (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Crinum Amabile (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Crinum Amoenum (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Crinum Asiaticum (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Crinum Brachynema (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Crinum Bulbispermum (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Crinum Defixum (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Crinum Erubescens (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Crinum Giganteum (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Crinum Jagus (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Crinum Kirkii (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Crinum Latifolium (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Crinum Laurentii (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Crinum Lorifolium (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Crinum Macowanii (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Crinum Macrantherum (Plant) Rel Props:Source_db:npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Crinum Moorei (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Crinum Powellii (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Crinum Pratense (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Crinum Stuhlmannii (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Crinum Viviparum (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Crinum Woodrowii (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Crinum Yemense (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Crinum Zeylanicum (Plant) Rel Props:Reference: