beta-Longipinene
PubChem CID: 25203064
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | beta-Longipinene, (1S,2R,7S,8S)-2,6,6-Trimethyl-9-methylenetricyclo[5.4.0.02,8]undecane, Tricyclo[5.4.0.02,8]undecane, 2,6,6-trimethyl-9-methylene-, (1S,2R,7S,8S)-, 2,6,6-trimethyl-9-methylidenetricyclo(5.4.0.02,8)undecane, 2,6,6-trimethyl-9-methylidenetricyclo[5.4.0.02,8]undecane, (1S,2R,7S,8S)-2,6,6-Trimethyl-9-methylenetricyclo(5.4.0.02,8)undecane, Tricyclo(5.4.0.02,8)undecane, 2,6,6-trimethyl-9-methylene-, (1S,2R,7S,8S)-, (-)-.beta.-Longipinene, CHEBI:192781, 41432-70-6, Q67879725, 2,6,6-trimethyl-9-methylidenetricyclo[5.4.0.0(2,8)]undecane |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2C3CCCCC2C13 |
| Np Classifier Class | Longipinane sesquiterpenoids |
| Deep Smiles | C=CCCCCC6C4C)CCCC7C)C |
| Heavy Atom Count | 15.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | CC1CCC2C3CCCCC2C13 |
| Classyfire Subclass | Monoterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 312.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,6,6-trimethyl-9-methylidenetricyclo[5.4.0.02,8]undecane |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 4.9 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C15H24 |
| Scaffold Graph Node Bond Level | C=C1CCC2C3CCCCC2C13 |
| Prediction Swissadme | 0.0 |
| Inchi Key | DQOVXHMHLOWECL-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.8666666666666667 |
| Logs | -6.143 |
| Rotatable Bond Count | 0.0 |
| Logd | 4.692 |
| Synonyms | beta-longipinene, β-lofoline, β-longipinene |
| Esol Class | Moderately soluble |
| Functional Groups | C=C(C)C |
| Compound Name | beta-Longipinene |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 204.188 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 204.188 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 204.35 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.162513399999999 |
| Inchi | InChI=1S/C15H24/c1-10-6-7-11-13-12(10)15(11,4)9-5-8-14(13,2)3/h11-13H,1,5-9H2,2-4H3 |
| Smiles | CC1(CCCC2(C3C1C2C(=C)CC3)C)C |
| Nring | 4.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Acalypha Fruticosa (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2012.10644095 - 2. Outgoing r'ship
FOUND_INto/from Artemisia Nilagirica (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2015.1083489 - 3. Outgoing r'ship
FOUND_INto/from Capsicum Annuum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Clinopodium Nepeta (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2007.10643585 - 5. Outgoing r'ship
FOUND_INto/from Clinopodium Vulgare (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2009.9700100 - 6. Outgoing r'ship
FOUND_INto/from Combretum Albidum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2017.1409659 - 7. Outgoing r'ship
FOUND_INto/from Cymbopogon Flexuosus (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2015.1007218 - 8. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2008.10643630 - 9. Outgoing r'ship
FOUND_INto/from Eryngium Foetidum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2006.10643499 - 10. Outgoing r'ship
FOUND_INto/from Ferula Ovina (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2008.10643640 - 11. Outgoing r'ship
FOUND_INto/from Globba Sessiliflora (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2012.692915 - 12. Outgoing r'ship
FOUND_INto/from Lycopodium Obscurum (Plant) Rel Props:Reference:ISBN:9788172362461 - 13. Outgoing r'ship
FOUND_INto/from Murraya Koenigii (Plant) Rel Props:Reference:ISBN:9770972795006 - 14. Outgoing r'ship
FOUND_INto/from Nigella Sativa (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2013.813275 - 15. Outgoing r'ship
FOUND_INto/from Origanum Vulgare (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.884772 - 16. Outgoing r'ship
FOUND_INto/from Pogostemon Cablin (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2012.705095 - 17. Outgoing r'ship
FOUND_INto/from Pulicaria Dysenterica (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2007.9699296 - 18. Outgoing r'ship
FOUND_INto/from Salvia Sclarea (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2016.1195292 - 19. Outgoing r'ship
FOUND_INto/from Santalum Album (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1718 - 20. Outgoing r'ship
FOUND_INto/from Tussilago Farfara (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2011.10643595 - 21. Outgoing r'ship
FOUND_INto/from Valeriana Jatamansi (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2012.705095 - 22. Outgoing r'ship
FOUND_INto/from Zingiber Zerumbet (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1940