5-Hydroxyisourate
PubChem CID: 250388
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5-Hydroxyisourate, 6960-30-1, DU6PJ7L9BX, 5-hydroxyisouric acid, 5-hydroxy-3,7-dihydropurine-2,6,8-trione, UNII-DU6PJ7L9BX, NSC 69826, NSC-69826, 5-Hydroxy-2,6-dioxo-2,5,6,7-tetrahydro-1H-purin-8-olate, 5-hydroxy-5,7-dihydro-1H-purine-2,6,8(9H)-trione, SCHEMBL997117, SCHEMBL11959537, SCHEMBL20520131, SCHEMBL21383432, CHEBI:18072, DTXSID10290591, NSC69826, 5H-PURINE-2,5,6,8-TETROL, Q2823232, 5-hydroxy-5,7-dihydro-1H-purine-2,6,8(3H)-trione, 5,7-DIHYDRO-5-HYDROXY-1H-PURINE-2,6,8(3H)-TRIONE, 5-hydroxy-2,3,5,6,7,8-hexahydro-1H-purine-2,6,8-trione |
|---|---|
| Topological Polar Surface Area | 120.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Inchi Key | LTQYPAVLAYVKTK-UHFFFAOYSA-N |
| Rotatable Bond Count | 0.0 |
| Synonyms | 5-Hydroxy-2,6-dioxo-2,5,6,7-tetrahydro-1H-purin-8-olate, 5-hydroxy-5,7-dihydro-1H-purine-2,6,8(9H)-trione |
| Heavy Atom Count | 13.0 |
| Compound Name | 5-Hydroxyisourate |
| Description | 5-Hydroxyisourate is a molecule with a formula of C5H4N4O4 and molecular weight of 184.110 g/mol. It is the product of the oxidation of uric acid by urate oxidase. 5-Hydroxyisourate is found in many foods, some of which are nance, cupuaçu, horned melon, and mentha (mint). |
| Exact Mass | 184.023 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 184.023 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 362.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 184.11 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5-hydroxy-3,7-dihydropurine-2,6,8-trione |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C5H4N4O4/c10-2-5(13)1(6-3(11)8-2)7-4(12)9-5/h13H,(H3,6,7,8,9,10,11,12) |
| Smiles | C12=NC(=O)NC1(C(=O)NC(=O)N2)O |
| Xlogp | -2.3 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C5H4N4O4 |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all