(1S,2R,4aS,9aS)-1-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-6-(hydroxymethyl)-1,2-dimethyl-3,4a,5,8,9,9a-hexahydro-2H-benzo[7]annulen-4-one
PubChem CID: 24978614
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | MLS000574941, CHEMBL1713764, CHEBI:182722, HMS2269M16, SMR001215797, (1S,2R,4aS,9aS)-1-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-6-(hydroxymethyl)-1,2-dimethyl-3,4a,5,8,9,9a-hexahydro-2H-benzo[7]annulen-4-one |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 77.8 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CCCC2CCCCCC12 |
| Deep Smiles | OC/C=C/CC[C@@]C)[C@H]C)CC=O)[C@@H][C@@H]6CCC=CC7)CO))))))))))))))CO |
| Heavy Atom Count | 24.0 |
| Classyfire Class | Fatty acyls |
| Scaffold Graph Node Level | OC1CCCC2CCCCCC12 |
| Classyfire Subclass | Fatty alcohols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 508.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Uniprot Id | Q96QE3, O75496, Q8WZA2, O94782 |
| Iupac Name | (1S,2R,4aS,9aS)-1-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-6-(hydroxymethyl)-1,2-dimethyl-3,4a,5,8,9,9a-hexahydro-2H-benzo[7]annulen-4-one |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 1.8 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C20H32O4 |
| Scaffold Graph Node Bond Level | O=C1CCCC2CCC=CCC12 |
| Prediction Swissadme | 1.0 |
| Inchi Key | LDOZOWGJNHIECR-LLBXSCRASA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.75 |
| Logs | -1.585 |
| Rotatable Bond Count | 6.0 |
| Logd | 1.807 |
| Synonyms | pilosanone b |
| Esol Class | Soluble |
| Functional Groups | C/C=C(/C)C, CC(C)=O, CC=C(C)C, CO |
| Compound Name | (1S,2R,4aS,9aS)-1-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-6-(hydroxymethyl)-1,2-dimethyl-3,4a,5,8,9,9a-hexahydro-2H-benzo[7]annulen-4-one |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 336.23 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 336.23 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 336.5 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Esol | -2.6515264 |
| Inchi | InChI=1S/C20H32O4/c1-14-10-19(24)17-11-16(13-23)4-3-5-18(17)20(14,2)8-6-15(12-22)7-9-21/h4,7,14,17-18,21-23H,3,5-6,8-13H2,1-2H3/b15-7-/t14-,17+,18+,20+/m1/s1 |
| Smiles | C[C@@H]1CC(=O)[C@H]2CC(=CCC[C@@H]2[C@@]1(C)CC/C(=C/CO)/CO)CO |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Diterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Agrimonia Pilosa (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Bidens Pilosa (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Calea Pilosa (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Curculigo Pilosa (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Elsholtzia Pilosa (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Euphorbia Pilosa (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Isolona Pilosa (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Oleandra Pilosa (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Portulaca Grandiflora (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Portulaca Guadrifida (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Portulaca Obracea (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Portulaca Oleracea (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Portulaca Pilosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Portulaca Quadrifida (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Portulaca Tuberosa (Plant) Rel Props:Reference:ISBN:9780387706375 - 16. Outgoing r'ship
FOUND_INto/from Vepris Pilosa (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Vigna Pilosa (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Viola Pilosa (Plant) Rel Props:Reference: