L-Galactose
PubChem CID: 24749
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2,3,4,5,6-pentahydroxyhexanal, 3458-28-4, Mannose, D-, L-Galactose, 93780-23-5, 2595-97-3, D-Glucose-3,4-13C2, 15572-79-9, D-(-)-GULOSE, D-(+)-Glucose, D-Mannose-3-13C, CHEBI:33917, 4205-23-6, alpha-D-Glucopyranose-1,6-13C2, Altrose, D-, NSC406891, 67759-25-5, D-(+) Glucose, L-(+)-Gulose, D-[2-13C]GALACTOSE, Glucose, liquid, 101615-89-8, Aldohexose, Galactose, D-, Dextrose, anhydrous, 5934-56-5, D-Allose-13C, Galactose, L- (8CI), D-Glucose-1,2-13C2, 31103-86-3, aldohexoses, Hexoses, NSC-2573, MFCD00136021, GLUCOSE, L-, [1-14C], NSC-224293, NSC-406891, Hexose #, NCGC00159408-02, 314062-47-0, GLUCOSE (D), D(+)-Glucose, anhydrous, SCHEMBL1812, (3R,4R,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol, 25191-16-6, D(+)-Glucose, (2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanal, SGCUT00120, CHEMBL1206211, SCHEMBL25931632, D-(+)-Galactose, plant derived, NSC2573, HMS3651M12, 2,3,4,5,6-pentahy-droxyhexanal, 110187-42-3, 138079-87-5, 8027-56-3, BEA61589, NSC26247, NSC83659, SCA75925, to_000009, VCA84927, VCA84928, NSC-83659, NSC224293, STL185552, AKOS009156817, SB40630, SB44733, SB44748, SB44794, SB44854, SB44882, SB45026, SB45057, SB45528, SB45632, SB46961, SY069569, SY073251, DB-043285, DB-044880, DB-045027, DB-048655, CS-0266345, EN300-49119, WLN: T6OTJ BQ CQ DQ EQ F1Q -D,GLU, F25D46D2-AF25-42CF-BA85-09669814B5DC |
|---|---|
| Topological Polar Surface Area | 118.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Heavy Atom Count | 12.0 |
| Description | β-d-galactose is a member of the class of compounds known as hexoses. Hexoses are monosaccharides in which the sugar unit is a is a six-carbon containing moeity. β-d-galactose is soluble (in water) and a very weakly acidic compound (based on its pKa). β-d-galactose can be found in a number of food items such as other cereal product, almond, sea-buckthornberry, and pepper (capsicum), which makes β-d-galactose a potential biomarker for the consumption of these food products. Galactose (galacto- + -ose, "milk sugar"), sometimes abbreviated Gal, is a monosaccharide sugar that is about as sweet as glucose, and about 30% as sweet as sucrose. It is a C-4 epimer of glucose . |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 138.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,3,4,5,6-pentahydroxyhexanal |
| Prediction Hob | 1.0 |
| Class | Organooxygen compounds |
| Xlogp | -2.9 |
| Superclass | Organic oxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Molecular Formula | C6H12O6 |
| Prediction Swissadme | 0.0 |
| Inchi Key | GZCGUPFRVQAUEE-UHFFFAOYSA-N |
| Fcsp3 | 0.8333333333333334 |
| Logs | 0.062 |
| Rotatable Bond Count | 5.0 |
| Logd | -2.465 |
| Synonyms | Anhydrous dextrose, D Glucose, D-Glucose, Dextrose, Dextrose, anhydrous, Glucose, Glucose monohydrate, Glucose, (DL)-isomer, Glucose, (L)-isomer, Glucose, (alpha-D)-isomer, Glucose, (beta-D)-isomer, Hexose, Hexoses, L Glucose, L-Glucose, Monohydrate, glucose |
| Compound Name | L-Galactose |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 180.063 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 180.063 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 180.16 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | 1.2252328000000001 |
| Inchi | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2 |
| Smiles | C(C(C(C(C(C=O)O)O)O)O)O |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Hexoses |
- 1. Outgoing r'ship
FOUND_INto/from Aloe Barbadensis (Plant) Rel Props:Source_db:npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Aloe Vera (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Changium Smyrnioides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Codonopsis Canescens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Codonopsis Pilosula (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Codonopsis Subglobosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Panax Ginseng (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Papaver Somniferum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Pogostemon Cablin (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Polygonatum Sibiricum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Sinopodophyllum Hexandrum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all