6-Deoxy-L-galactonolactone
PubChem CID: 242516
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 20031-16-7, 6-Deoxy-L-galactonolactone, 3,4-Dihydroxy-5-(1-hydroxyethyl)dihydrofuran-2(3H)-one, 6-Deoxy-D-mannono-4-lactone, 1-Rhamnono-1,4-lactone, SCHEMBL15257411, SCHEMBL21575607, VASLEPDZAKCNJX-UHFFFAOYSA-N, NSC51238, NSC-51238, NS00051107, 24286-61-1 |
|---|---|
| Topological Polar Surface Area | 87.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | VASLEPDZAKCNJX-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Heavy Atom Count | 11.0 |
| Compound Name | 6-Deoxy-L-galactonolactone |
| Kingdom | Organic compounds |
| Description | 1-rhamnono-1,4-lactone is a member of the class of compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. 1-rhamnono-1,4-lactone is soluble (in water) and a very weakly acidic compound (based on its pKa). 1-rhamnono-1,4-lactone can be found in rice, which makes 1-rhamnono-1,4-lactone a potential biomarker for the consumption of this food product. |
| Exact Mass | 162.053 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 162.053 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 168.0 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 162.14 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-one |
| Total Atom Stereocenter Count | 4.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Lactones |
| Inchi | InChI=1S/C6H10O5/c1-2(7)5-3(8)4(9)6(10)11-5/h2-5,7-9H,1H3 |
| Smiles | CC(C1C(C(C(=O)O1)O)O)O |
| Xlogp | -1.0 |
| Superclass | Organoheterocyclic compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Gamma butyrolactones |
| Taxonomy Direct Parent | Gamma butyrolactones |
| Molecular Formula | C6H10O5 |
- 1. Outgoing r'ship
FOUND_INto/from Oryza Sativa (Plant) Rel Props:Source_db:fooddb_chem_all