Vindolinine
PubChem CID: 24148538
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Vindolinine, 5980-02-9, Vindolinin, methyl (1R,9R,10R,12R,19S,20R)-20-methyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6,13-tetraene-10-carboxylate, CHEBI:141964, (2alpha,3beta,5alpha,12beta,19alpha,20R)-6,7-Didehydro-2,20-cycloaspidospermidine-3-carbox ylic acid, methyl ester, methyl (3beta,5alpha,12beta,19alpha,20R)-6,7-didehydro-2,20-cycloaspidospermidine-3-carboxylate, (-)-vindolinine, methyl (1R,9R,10R,12R,19S,20R)-20-methyl-8,16-diazahexacyclo(10.6.1.19,12.01,9.02,7.016,19)icosa-2,4,6,13-tetraene-10-carboxylate, MEGxp0_001942, CHEMBL1165590, HY-N5122, AKOS040760748, CS-0032446, NS00094424, Methyl 6,7-didehydro-2,20-cycloaspidospermidine-3-carboxylic acid, (2 alpha,3 beta,5 alpha,12 beta,19 alpha,20R)-6,7-didehydro-2,20-cycloaspidospermidine-3-carbox ylic acid, methyl ester |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 41.6 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CC13CCC4(CCCC5CCC21C54)C3 |
| Np Classifier Class | Aspidosperma type |
| Deep Smiles | COC=O)[C@@H]C[C@@][C@H][C@@]5Ncc[C@]5[C@H]8NCC5))CC=C%12))))))cccc6))))))))C |
| Heavy Atom Count | 25.0 |
| Classyfire Class | Indoles and derivatives |
| Scaffold Graph Node Level | C1CCC2C(C1)NC13CCC4(CCCN5CCC21C54)C3 |
| Classyfire Subclass | Carbazoles |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 677.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | methyl (1R,9R,10R,12R,19S,20R)-20-methyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6,13-tetraene-10-carboxylate |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 2.9 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C21H24N2O2 |
| Scaffold Graph Node Bond Level | C1=CC23CCC4(C2)Nc2ccccc2C42CCN(C1)C32 |
| Prediction Swissadme | 1.0 |
| Inchi Key | JSLDLCGKZDUQSH-SBDPWIONSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.5714285714285714 |
| Logs | -4.074 |
| Rotatable Bond Count | 2.0 |
| Logd | 1.495 |
| Synonyms | vindolinine |
| Esol Class | Soluble |
| Functional Groups | CC=CC, CN(C)C, COC(C)=O, cNC |
| Compound Name | Vindolinine |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 336.184 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 336.184 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 336.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.804797 |
| Inchi | InChI=1S/C21H24N2O2/c1-13-19-8-5-10-23-11-9-20(18(19)23)14-6-3-4-7-16(14)22-21(13,20)15(12-19)17(24)25-2/h3-8,13,15,18,22H,9-12H2,1-2H3/t13-,15+,18+,19+,20-,21-/m1/s1 |
| Smiles | C[C@@H]1[C@]23C[C@H]([C@@]14[C@@]5([C@H]2N(CC5)CC=C3)C6=CC=CC=C6N4)C(=O)OC |
| Nring | 6.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tryptophan alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Acritopappus Longifolius (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Boerhavia Erecta (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Catharanthus Lanceus (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Catharanthus Longifolius (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Catharanthus Ovalis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Catharanthus Pusillus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Catharanthus Roseus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all; Reference: - 8. Outgoing r'ship
FOUND_INto/from Coelogyne Ovalis (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Commelina Erecta (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Duranta Erecta (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Eclipta Erecta (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Halophila Ovalis (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Hygrophila Erecta (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Hyoscyamus Pusillus (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Melodinus Balansae (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Melodinus Celastroides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Melodinus Cochinchinensis (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Melodinus Hemsleyanus (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Melodinus Tenuicaudatus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Nepeta Erecta (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Ochrocarpos Longifolius (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Senecio Longifolius (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Senecio Roseus (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Stephania Erecta (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Tagetes Erecta (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Thunbergia Erecta (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Vinca Erecta (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 28. Outgoing r'ship
FOUND_INto/from Vinca Herbacea (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Vinca Major (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Vinca Minor (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Vinca Parviflora (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Vinca Pusilla (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Vinca Rosea (Plant) Rel Props:Reference: