Dihydrowogonin 7-glucoside
PubChem CID: 23757169
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Dihydrowogonin 7-glucoside, MEGxp0_000074, ACon1_000338, NCGC00169172-01, BRD-A99543367-001-01-3 |
|---|---|
| Topological Polar Surface Area | 155.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | BZGHUZGALXIEBL-UHFFFAOYSA-N |
| Rotatable Bond Count | 5.0 |
| Synonyms | Dihydrowogonin 7-glucoside, Dihydrowogonin 7-O-b-D-glucopyranoside, Dihydrowogonin 7-O-glucoside |
| Heavy Atom Count | 32.0 |
| Compound Name | Dihydrowogonin 7-glucoside |
| Description | Dihydrowogonin 7-glucoside is a member of the class of compounds known as flavonoid-7-o-glycosides. Flavonoid-7-o-glycosides are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C7-position. Dihydrowogonin 7-glucoside is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Dihydrowogonin 7-glucoside can be found in sour cherry, which makes dihydrowogonin 7-glucoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 448.137 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 448.137 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 640.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 448.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5-hydroxy-8-methoxy-2-phenyl-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C22H24O10/c1-29-20-14(31-22-19(28)18(27)17(26)15(9-23)32-22)8-12(25)16-11(24)7-13(30-21(16)20)10-5-3-2-4-6-10/h2-6,8,13,15,17-19,22-23,25-28H,7,9H2,1H3 |
| Smiles | COC1=C(C=C(C2=C1OC(CC2=O)C3=CC=CC=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
| Xlogp | 0.9 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C22H24O10 |
- 1. Outgoing r'ship
FOUND_INto/from Prunus Cerasus (Plant) Rel Props:Source_db:fooddb_chem_all