Tetramethylsuccinamide
PubChem CID: 23752
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 7334-51-2, N,N,N',N'-Tetramethylsuccinamide, N,N,N',N'-Tetramethylsuccinyldiamide, N,N,N',N'-tetramethylbutanediamide, TETRAMETHYLSUCCINAMIDE, N,N,N,N-TETRAMETHYLSUCCINYLDIAMIDE, M8NMC2G8MR, EINECS 230-838-4, TETRAMETHYL SUCCINAMIDE, DTXSID00223570, SUCCINAMIDE, N,N,N',N'-TETRAMETHYL-, BUTANEDIAMIDE, N1,N1,N4,N4-TETRAMETHYL-, UNII-M8NMC2G8MR, Butanediamide, N,N,N',N'-tetramethyl-, SCHEMBL1191256, DTXCID30146061, RCWUFNWXCIKHPC-UHFFFAOYSA-N, N1,N1,N4,N4-tetramethylsuccinamide, STK033652, AKOS005381853, BS-49170, CS-0162953, NS00037502, E75877, Q27283651, 230-838-4 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 40.6 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Deep Smiles | CNC=O)CCC=O)NC)C))))))C |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty amides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 156.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | N,N,N',N'-tetramethylbutanediamide |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | -0.9 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C8H16N2O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | RCWUFNWXCIKHPC-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.75 |
| Logs | 0.523 |
| Rotatable Bond Count | 3.0 |
| Logd | -1.306 |
| Synonyms | n,n,n',n'-tetramethyl succinamide, n,n,n',n'-tetramethylsuccinamide |
| Esol Class | Very soluble |
| Functional Groups | CC(=O)N(C)C |
| Compound Name | Tetramethylsuccinamide |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 172.121 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 172.121 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 172.22 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -0.004513599999999729 |
| Inchi | InChI=1S/C8H16N2O2/c1-9(2)7(11)5-6-8(12)10(3)4/h5-6H2,1-4H3 |
| Smiles | CN(C)C(=O)CCC(=O)N(C)C |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Curculigo Orchioides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all