Medicarpin 3-O-glucoside
PubChem CID: 23724664
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (-)-Medicocarpin, Medicarpin 3-O-glucoside, 52766-70-8, Medicarpin glucoside, (-)-medicarpin-3-O-glucoside, (2S,3R,4S,5S,6R)-2-[[(6aR,11aR)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol, CHEBI:80390, beta-D-Glucopyranoside, (6aR,11aR)-6a,11a-dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-yl, Medicocarpin, Medicarpin-3-O-glucoside, Medicocarpin, (-)-, Medicarpin beta-D-glucoside, CHEMBL517330, 87822F2QJH, DTXSID501312756, HY-N9128, AKOS040762031, Medicarpin 3-O-beta-D-glucopyranoside, CS-0158810, Q27149413, (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-{[(1R,10R)-14-methoxy-8,17-dioxatetracyclo[8.7.0.0^{2,7}.0^{11,16}]heptadeca-2,4,6,11(16),12,14-hexaen-5-yl]oxy}oxane-3,4,5-triol, (6aR,11aR)-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-yl beta-D-glucopyranoside, beta-D-Glucopyranoside, 6a,11a-dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-yl, (6aR-cis)- |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 127.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCC(CC2CCC3C(CCC4C5CCCCC5CC34)C2)CC1 |
| Np Classifier Class | Pterocarpan |
| Deep Smiles | OC[C@H]O[C@@H]Occcccc6)OC[C@@H][C@H]6Occ5cccc6)OC))))))))))))))))))[C@@H][C@H][C@@H]6O))O))O |
| Heavy Atom Count | 31.0 |
| Classyfire Class | Isoflavonoids |
| Description | (-)-medicarpin-3-o-glucoside is a member of the class of compounds known as pterocarpans. Pterocarpans are benzo-pyrano-furano-benzene compounds, containing the 6H-[1]benzofuro[3,2-c]chromene skeleton. They are derivatives of isoflavonoids (-)-medicarpin-3-o-glucoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). (-)-medicarpin-3-o-glucoside can be found in a number of food items such as pine nut, cupuaçu, olive, and almond, which makes (-)-medicarpin-3-o-glucoside a potential biomarker for the consumption of these food products. |
| Scaffold Graph Node Level | C1CCC(OC2CCC3C(C2)OCC2C4CCCCC4OC32)OC1 |
| Classyfire Subclass | Furanoisoflavonoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 620.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 7.0 |
| Iupac Name | (2S,3R,4S,5S,6R)-2-[[(6aR,11aR)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Isoflavonoids |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 0.8 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Subclass | Furanoisoflavonoids |
| Gsk 4 400 Rule | False |
| Molecular Formula | C22H24O9 |
| Scaffold Graph Node Bond Level | c1ccc2c(c1)OC1c3ccc(OC4CCCCO4)cc3OCC21 |
| Prediction Swissadme | 1.0 |
| Inchi Key | PVEMGMOWXQUWRD-NJAOXFEXSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.4545454545454545 |
| Logs | -4.168 |
| Rotatable Bond Count | 4.0 |
| Logd | 1.712 |
| Synonyms | Medicarpin 3-O-glucoside, medicarpin 3-o-(6-malonylglucoside)-3-hydroxy-9-methoxypterocarpan, medicocarpin |
| Esol Class | Soluble |
| Functional Groups | CO, cOC, cO[C@@H](C)OC |
| Compound Name | Medicarpin 3-O-glucoside |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 432.142 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 432.142 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 432.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 7.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -3.053786612903226 |
| Inchi | InChI=1S/C22H24O9/c1-27-10-2-4-12-14-9-28-15-7-11(3-5-13(15)21(14)30-16(12)6-10)29-22-20(26)19(25)18(24)17(8-23)31-22/h2-7,14,17-26H,8-9H2,1H3/t14-,17+,18+,19-,20+,21-,22+/m0/s1 |
| Smiles | COC1=CC2=C(C=C1)[C@@H]3COC4=C([C@@H]3O2)C=CC(=C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Pterocarpans |
| Np Classifier Superclass | Isoflavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Aconitum Orientale (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Ceanothus Integerrimus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Medicago Sativa (Plant) Rel Props:Reference:https://doi.org/10.2174/0929867033456729 - 4. Outgoing r'ship
FOUND_INto/from Ononis Spinosa (Plant) Rel Props:Source_db:npass_chem_all