CID 23697378
PubChem CID: 23697378
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | MLS001306463, SMR000718804, AKOS030511357 |
|---|---|
| Topological Polar Surface Area | 81.6 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | QGMRQYFBGABWDR-UHFFFAOYSA-M |
| Rotatable Bond Count | 4.0 |
| Synonyms | Ananase, Bromelase, E.C. 3.4.22.32 (stem bromelain), E.C. 3.4.22.33 (fruit bromelain), Extranase, Inflamen, Traumanase |
| Heavy Atom Count | 17.0 |
| Compound Name | CID 23697378 |
| Description | Enzymes occurring in pineapple juice (Ananas sativus), used in tenderising meat and chill-proofing beer [DFC] Along with papain, bromelain is one of the most popular substances to use for meat tenderizing., Bromelain can refer to one of two protease enzymes extracted from the plant family Bromeliaceae, or it can refer to a combination of those enzymes along with other compounds produced in an extract. [BioSpider]. Bromelains is found in pineapple and fruits. |
| Exact Mass | 248.114 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 248.114 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 344.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 248.25 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 2.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | sodium, 5-ethyl-2,6-dioxo-5-pentan-2-ylpyrimidin-4-olate |
| Total Atom Stereocenter Count | 2.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C11H18N2O3.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15, /h7H,4-6H2,1-3H3,(H2,12,13,14,15,16), /q, +1/p-1 |
| Smiles | CCCC(C)C1(C(=O)NC(=O)N=C1[O-])CC.[Na+] |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C11H17N2NaO3 |
- 1. Outgoing r'ship
FOUND_INto/from Ananas Comosus (Plant) Rel Props:Source_db:fooddb_chem_all