Potassium hydrogen oxalate
PubChem CID: 23662386
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Potassium hydrogen oxalate, Potassium binoxalate, 127-95-7, Kleesalz, POTASSIUM ACID OXALATE, Salt of sorrel, Potassium carboxyformate, Ethanedioic acid, potassium salt (1:1), Monopotassium oxalate, Sal Acetosella, Potassium oxalate (KHC2O4), Oxalic acid, monopotassium salt, Potassium quadroxalate, Ethanedioic acid, monopotassium salt, potassium, 2-hydroxy-2-oxoacetate, L3W2519LG2, Sorrel salt, Kleesalz [German], Essential salt of lemon, Potassium salt of sorrel, HSDB 671, EINECS 204-873-0, UNII-L3W2519LG2, Potassium binoxylate, EC 204-873-0, DTXSID6059572, POTASSIUM BINOXALATE [MI], JMTCDHVHZSGGJA-UHFFFAOYSA-M, AKOS027382595, FP40448, HY-W115775, CS-0198035, NS00078118, Q906025 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 77.4 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | True |
| Deep Smiles | OC=O)C=O)[O-].[K+] |
| Heavy Atom Count | 7.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Description | Potassium binoxylate belongs to dicarboxylic acids and derivatives class of compounds. Those are organic compounds containing exactly two carboxylic acid groups. Potassium binoxylate is soluble (in water) and a moderately acidic compound (based on its pKa). Potassium binoxylate can be found in sorrel, which makes potassium binoxylate a potential biomarker for the consumption of this food product. |
| Classyfire Subclass | Dicarboxylic acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 87.7 |
| Database Name | fooddb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | potassium, 2-hydroxy-2-oxoacetate |
| Nih Violation | True |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C2HKO4 |
| Inchi Key | JMTCDHVHZSGGJA-UHFFFAOYSA-M |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | potassium binoxalate, potassium hydrogen oxalate |
| Esol Class | Very soluble |
| Functional Groups | O=C([O-])C(=O)O, [K+] |
| Compound Name | Potassium hydrogen oxalate |
| Exact Mass | 127.951 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 127.951 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 128.13 |
| Gi Absorption | False |
| Covalent Unit Count | 2.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C2H2O4.K/c3-1(4)2(5)6, /h(H,3,4)(H,5,6), /q, +1/p-1 |
| Smiles | C(=O)(C(=O)[O-])O.[K+] |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
- 1. Outgoing r'ship
FOUND_INto/from Rumex Acetosa (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Rumex Vesicarius (Plant) Rel Props:Reference:ISBN:9780387706375