Isobornyl formate
PubChem CID: 23623868
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1200-67-5, Isobornyl formate, Isobornyl methanoate, Isoborneol formate, Isoborneol, formate, FEMA No. 2162, Bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl-, 2-formate, (1R,2R,4R)-rel-, 8QPT973QF4, rel-(1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl formate, EXO-2-BORNYL FORMATE, Bornyl formate, EXO-2-CAMPHANYL FORMATE, ISOBORNYL FORMATE [FHFI], CHEBI:132828, BICYCLO(2.2.1)HEPTAN-2-OL, 1,7,7-TRIMETHYL-, FORMATE, EXO-, Bicyclo(2.2.1)heptan-2-ol, 1,7,7-trimethyl-, 2-formate, (1R,2R,4R)-rel-, 1,7,7-Trimethylbicyclo(2.2.1)heptan-2-yl formate, exo-, exo-1,7,7-Trimethylbicyclo(2.2.1)hept-2-yl formate, Exo-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl formate, Bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl-, formate, exo-, Bicyclo(2.2.1)heptan-2-ol, 1,7,7-trimethyl-, formate, (1R,2R,4R)-rel-, Bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl-, formate, (1R,2R,4R)-rel-, 2-Bornyl formate, exo-, 2-Camphanyl formate, exo-, DTXSID30881243, UNII-8QPT973QF4, ((1R,2R,4R)-1,7,7-trimethyl-2-bicyclo(2.2.1)heptanyl) formate, [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] formate, rel-(1R,2R,4R)-1,7,7-trimethylbicyclo(2.2.1)heptan-2-yl formate, EINECS 214-853-3, MFCD00135983, ISOBORNYLFORMATE, Bornyl (iso) formate, AI3-09494, RDWUNORUTVEHJF-KKZNHRDASA-N, (+/-)-ISOBORNYL FORMATE, DTXCID001505095, ISOBORNYL FORMATE, (+/-)-, AKOS028113130, AS-76540, CS-0196560, A11432, Q27270907, rel-(1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ylformate, Bicyclo2.2.1heptan-2-ol, 1,7,7-trimethyl-, formate, (1R,2R,4R)-rel- |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CC2CCC1C2 |
| Np Classifier Class | Camphane monoterpenoids |
| Deep Smiles | O=CO[C@@H]C[C@@H]C[C@@]5C)CC5)))C)C |
| Heavy Atom Count | 13.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | C1CC2CCC1C2 |
| Classyfire Subclass | Monoterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 234.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] formate |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.3 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C11H18O2 |
| Scaffold Graph Node Bond Level | C1CC2CCC1C2 |
| Inchi Key | RDWUNORUTVEHJF-KKZNHRDASA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | isobornyl formate |
| Esol Class | Soluble |
| Functional Groups | COC=O |
| Compound Name | Isobornyl formate |
| Exact Mass | 182.131 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 182.131 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 182.26 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C11H18O2/c1-10(2)8-4-5-11(10,3)9(6-8)13-7-12/h7-9H,4-6H2,1-3H3/t8-,9-,11+/m1/s1 |
| Smiles | C[C@@]12CC[C@@H](C1(C)C)C[C@H]2OC=O |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Achillea Millefolium (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2006.9699093 - 2. Outgoing r'ship
FOUND_INto/from Ageratum Conyzoides (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.884775 - 3. Outgoing r'ship
FOUND_INto/from Alpinia Calcarata (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2005.9698941 - 4. Outgoing r'ship
FOUND_INto/from Aquilaria Malaccensis (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2011.9700468 - 5. Outgoing r'ship
FOUND_INto/from Eucalyptus Dealbata (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2007.9699215 - 6. Outgoing r'ship
FOUND_INto/from Lavandula Angustifolia (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3145 - 7. Outgoing r'ship
FOUND_INto/from Lavandula Stoechas (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2019.1642800 - 8. Outgoing r'ship
FOUND_INto/from Mentha Pulegium (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2019.1642800 - 9. Outgoing r'ship
FOUND_INto/from Nigella Sativa (Plant) Rel Props:Reference:https://doi.org/10.1080/0972-060x.2003.10643331 - 10. Outgoing r'ship
FOUND_INto/from Ocimum Tenuiflorum (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2005.9698880 - 11. Outgoing r'ship
FOUND_INto/from Origanum Onites (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2009.10643745 - 12. Outgoing r'ship
FOUND_INto/from Perilla Frutescens (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2012.755478 - 13. Outgoing r'ship
FOUND_INto/from Pinus Wallichiana (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2015.1038090 - 14. Outgoing r'ship
FOUND_INto/from Psidium Guajava (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2018.1431152 - 15. Outgoing r'ship
FOUND_INto/from Rosmarinus Officinalis (Plant) Rel Props:Reference:https://doi.org/10.1080/0972-060x.2003.10643331 - 16. Outgoing r'ship
FOUND_INto/from Satureja Montana (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2009.10643720