Heptacosanoic acid
PubChem CID: 23524
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | HEPTACOSANOIC ACID, 7138-40-1, Carboceric acid, C27:0, 9J1CDT7DOJ, EINECS 230-436-9, MFCD00014029, DTXSID5075070, CHEBI:78710, HeptacosanoicAcid, UNII-9J1CDT7DOJ, heptacosanoate, hydron, n-Heptacosanoic Acid, C26H53COOH, SCHEMBL159308, DTXCID8047000, LMFA01010027, AKOS015839867, FA 27:0, HY-W127566, AS-57029, FA(27:0), Heptacosanoic acid, ~99% (capillary GC), DB-055520, CS-0185788, H0971, NS00043169, T72867, Q15410999, 563CBB30-089B-45E1-BE24-439806FB6FF4, 230-436-9 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Unsaturated fatty acids |
| Deep Smiles | CCCCCCCCCCCCCCCCCCCCCCCCCCC=O)O |
| Heavy Atom Count | 29.0 |
| Classyfire Class | Fatty acyls |
| Description | Heptacosanoic acid is a fatty acid found in follicular casts (the abnormal impactation of a sebaceous follicle) implicated as the preclinical lesion of acne vulgaris. (PMID: 2940302) Heptacosanoic acid is one of the fatty acids found that contribute to a significant increase in the microviscosity of erythrocyte membranes in patients affected with adrenoleukodystrophy (ALD) and adrenomyeloneuropathy (AMN). (PMID: 6874949) Heptacosanoic acid has been found in the adrenal cortex and brain, in adrenoleukodystrophy and Zellweger syndrome in humans. (PMID: 3806133) Heptacosanoic acid has been found in blood and tissues of patients with different genetic peroxisomal disorder (Refsum's disease, X-linked adrenoleukodystrophy, neonatal adrenoleukodystrophy or Zellweger syndrome). (PMID: 2474624) [HMDB] |
| Classyfire Subclass | Fatty acids and conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 314.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | heptacosanoic acid |
| Prediction Hob | 0.0 |
| Class | Fatty Acyls |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 12.3 |
| Superclass | Lipids and lipid-like molecules |
| Subclass | Fatty acids and conjugates |
| Gsk 4 400 Rule | False |
| Molecular Formula | C27H54O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | VXZBFBRLRNDJCS-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.9629629629629628 |
| Logs | -6.985 |
| Rotatable Bond Count | 25.0 |
| State | Solid |
| Logd | 4.029 |
| Synonyms | C27:0, Carbocerate, Carboceric acid, Heptacosanoate, Heptacosanoic acid, heptacosanoic acid |
| Substituent Name | Very long-chain fatty acid, Straight chain fatty acid, Monocarboxylic acid or derivatives, Carboxylic acid, Carboxylic acid derivative, Hydrocarbon derivative, Organooxygen compound, Carbonyl group, Aliphatic acyclic compound |
| Esol Class | Poorly soluble |
| Functional Groups | CC(=O)O |
| Compound Name | Heptacosanoic acid |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 410.412 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 410.412 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 410.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -8.9769074 |
| Inchi | InChI=1S/C27H54O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(28)29/h2-26H2,1H3,(H,28,29) |
| Smiles | CCCCCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Very long-chain fatty acids |
| Np Classifier Superclass | Fatty Acids and Conjugates |
- 1. Outgoing r'ship
FOUND_INto/from Adiantum Incisum (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Aglaia Forbesii (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Arnebia Nobilis (Plant) Rel Props:Reference:ISBN:9788185042084 - 4. Outgoing r'ship
FOUND_INto/from Asarum Forbesii (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Cassia Fistula (Plant) Rel Props:Reference:ISBN:9788172362089 - 6. Outgoing r'ship
FOUND_INto/from Cynomorium Songaricum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Hansenia Forbesii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Hansenia Weberbaueriana (Plant) Rel Props:Source_db:cmaup_ingredients - 9. Outgoing r'ship
FOUND_INto/from Inula Grantioides (Plant) Rel Props:Reference:ISBN:9788185042145 - 10. Outgoing r'ship
FOUND_INto/from Ostericum Grosseserratum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Phyllanthus Amarus (Plant) Rel Props:Reference:ISBN:9788171360536 - 12. Outgoing r'ship
FOUND_INto/from Senna Occidentalis (Plant) Rel Props:Reference:ISBN:9788172362089 - 13. Outgoing r'ship
FOUND_INto/from Senna Siamea (Plant) Rel Props:Reference:ISBN:9788172362089 - 14. Outgoing r'ship
FOUND_INto/from Strobilanthes Callosa (Plant) Rel Props:Reference:ISBN:9770972795006; ISBN:9788185042084 - 15. Outgoing r'ship
FOUND_INto/from Terminalia Alata (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Terminalia Arjuna (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Terminalia Bellirica (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Terminalia Bialata (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Terminalia Brachystemma (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Terminalia Calamansanay (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Terminalia Catappa (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Terminalia Chebula (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 23. Outgoing r'ship
FOUND_INto/from Terminalia Citrina (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Terminalia Coriacea (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Terminalia Crenulata (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Terminalia Elliptica (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Terminalia Macroptera (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Terminalia Myriocarpa (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Terminalia Pallida (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Terminalia Paniculata (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Terminalia Procera (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Terminalia Tomentosa (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Terminalia Travancorensis (Plant) Rel Props:Reference: