6,10,14-Trimethyl-2-methylenepentadecanal
PubChem CID: 23286475
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 6,10,14-Trimethyl-2-methylenepentadecanal, 6,10,14-trimethyl-2-methylidenepentadecanal, 83725-57-9, SCHEMBL7566080, CHEBI:231230, DTXSID101270481, 2-methylidene-6,10,14-trimethylpentadecanal |
|---|---|
| Topological Polar Surface Area | 17.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 20.0 |
| Description | Constituent of Tetragonia tetragonoides (New Zealand spinach). 6,10,14-Trimethyl-2-methylenepentadecanal is found in green vegetables and new zealand spinach. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 254.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6,10,14-trimethyl-2-methylidenepentadecanal |
| Nih Violation | True |
| Class | Prenol lipids |
| Xlogp | 7.8 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Sesquiterpenoids |
| Molecular Formula | C19H36O |
| Inchi Key | PTFJEDBJXCZCDO-UHFFFAOYSA-N |
| Rotatable Bond Count | 13.0 |
| Compound Name | 6,10,14-Trimethyl-2-methylenepentadecanal |
| Kingdom | Organic compounds |
| Exact Mass | 280.277 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 280.277 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 280.5 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Inchi | InChI=1S/C19H36O/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20/h15-18H,5-14H2,1-4H3 |
| Smiles | CC(C)CCCC(C)CCCC(C)CCCC(=C)C=O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Tetragonia Tetragonioides (Plant) Rel Props:Source_db:fooddb_chem_all