9-cis-Capsanthin
PubChem CID: 23258404
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 9-cis-Capsanthin, (2E,4E,6E,8E,10E,12E,14E,16Z,18E)-19-((4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-1-((1R,4S)-4-hydroxy-1,2,2-trimethylcyclopentyl)-4,8,13,17-tetramethylnonadeca-2,4,6,8,10,12,14,16,18-nonaen-1-one, (2E,4E,6E,8E,10E,12E,14E,16Z,18E)-19-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-1-[(1R,4S)-4-hydroxy-1,2,2-trimethylcyclopentyl]-4,8,13,17-tetramethylnonadeca-2,4,6,8,10,12,14,16,18-nonaen-1-one, 62741-96-2 |
|---|---|
| Topological Polar Surface Area | 57.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | VYIRVAXUEZSDNC-CYGCORCPSA-N |
| Rotatable Bond Count | 11.0 |
| Heavy Atom Count | 43.0 |
| Compound Name | 9-cis-Capsanthin |
| Kingdom | Organic compounds |
| Description | 9-cis-capsanthin is a member of the class of compounds known as xanthophylls. Xanthophylls are carotenoids containing an oxygenated carotene backbone. Carotenes are characterized by the presence of two end-groups (mostly cyclohexene rings, but also cyclopentene rings or acyclic groups) linked by a long branched alkyl chain. Carotenes belonging form a subgroup of the carotenoids family. Xanthophylls arise by oxygenation of the carotene backbone. 9-cis-capsanthin is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). 9-cis-capsanthin can be found in a number of food items such as yellow bell pepper, green bell pepper, red bell pepper, and pepper (c. annuum), which makes 9-cis-capsanthin a potential biomarker for the consumption of these food products. |
| Exact Mass | 584.423 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 584.423 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1310.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 584.9 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (2E,4E,6E,8E,10E,12E,14E,16Z,18E)-19-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-1-[(1R,4S)-4-hydroxy-1,2,2-trimethylcyclopentyl]-4,8,13,17-tetramethylnonadeca-2,4,6,8,10,12,14,16,18-nonaen-1-one |
| Total Atom Stereocenter Count | 3.0 |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Total Bond Stereocenter Count | 9.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C40H56O3/c1-29(17-13-19-31(3)21-23-36-33(5)25-34(41)26-38(36,6)7)15-11-12-16-30(2)18-14-20-32(4)22-24-37(43)40(10)28-35(42)27-39(40,8)9/h11-24,34-35,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19-,32-20+/t34-,35+,40+/m1/s1 |
| Smiles | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C\C=C\C(=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C(=O)[C@@]2(C[C@H](CC2(C)C)O)C)\C)/C |
| Xlogp | 10.6 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 9.0 |
| Subclass | Tetraterpenoids |
| Taxonomy Direct Parent | Xanthophylls |
| Molecular Formula | C40H56O3 |
- 1. Outgoing r'ship
FOUND_INto/from Capsicum Annuum (Plant) Rel Props:Source_db:fooddb_chem_all