DL-Arginine
PubChem CID: 232
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | DL-Arginine, 7200-25-1, Arginine, DL-, 2-amino-5-guanidinopentanoic acid, (+-)-Arginine, FL26NTK3EP, L(+)-Arginine, MFCD00063117, CCRIS 8597, 7004-12-8, EINECS 230-571-3, DL-2-Amino-5-guanidinopentanoic acid, arginin, DTXSID8022618, DL-Arginine Hydrate, D(-)-Arginine, C6H14N4O2, D-Arg, WLN: MUYZM3YZVQ &GH, Arginine monohydrochloride, L-(+)-, UNII-FL26NTK3EP, 2-amino-5-carbamimidamidopentanoic acid, Harg, DL arginine, NSC206269, 3h-arginine, Arginine #, NCGC00015064-02, Amino acid(Arg-), L-arginine, Arginine, 2-amino-5-(carbamimidamido)pentanoic acid, arginine + ornithine, DL-2-amino-5-guanidovaleric acid, L-ARGININE,, Arg130, SCHEMBL1790, SCHEMBL290308, DTXCID902618, SCHEMBL13337955, CHEBI:29016, 2-amino-5-guanidino-valeric acid, N~5~-(diaminomethylidene)ornithine, Ornithine, N5-(aminoiminomethyl)-, BCP29342, BCP34416, HY-N0454, BBL028093, DL-Arginine, >=97.0% (NT), pentanoic acid, 2-amino-5-guanido-, s5549, STL186110, STL191431, AKOS001042136, AKOS016050614, AKOS022902523, CCG-266392, FA29198, Norvaline, 5-[(aminoiminomethyl)amino]-, AS-14180, DA-62936, SY018359, SY061688, (+/-)-2-Amino-5-guanidinopentanoic acid, DB-043338, DB-227241, CS-0008983, NS00005927, EN300-34006, C02385, 2-azaniumyl-5-(diaminomethylideneamino)pentanoate, L000918, H-D-Arg-OH, (R)-2-amino-5-guanidinopentanoic acid, Pentanoic acid, 2-amino-5-[(aminoiminomethyl)amino]-, Q27104032, Z56896349, L-Arginine, from non-animal source, suitable for cell culture, (+/-)-2-Amino-5-guanidinopentanoic acid, DL-2-Amino-5-guanidinovaleric acid, H-DL-Arg-OH, (S)-(+)-Arginine, 2-Amino-5-guanidinovaleric acid, 2-Amino-5-guanidinopentanoic acid, 230-571-3, InChI=1/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10 |
|---|---|
| Topological Polar Surface Area | 128.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 12.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 176.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Carboxylic acids and derivatives |
| Xlogp | -4.2 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C6H14N4O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | ODKSFYDXXFIFQN-UHFFFAOYSA-N |
| Fcsp3 | 0.6666666666666666 |
| Rotatable Bond Count | 5.0 |
| Synonyms | 2-Amino-5-(carbamimidamido)pentanoic acid, 2-Amino-5-guanidinopentanoic acid, 2-Amino-5-guanidinovaleric acid, Arginin, Harg, 2-Amino-5-(carbamimidamido)pentanoate, 2-Amino-5-guanidinopentanoate, 2-Amino-5-guanidinovalerate, Arginine |
| Compound Name | DL-Arginine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 174.112 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 174.112 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 174.2 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | 2.1219352000000007 |
| Inchi | InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| Smiles | C(CC(C(=O)O)N)CN=C(N)N |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Arginine and derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Chlamydomonas Reinhardtii (Plant) Rel Props:Source_db:cmaup_ingredients