4H-Pyran-4-one, 3-hydroxy-2,6-dimethyl-
PubChem CID: 228129
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2298-99-9, 4H-Pyran-4-one, 3-hydroxy-2,6-dimethyl-, DTXSID80879099, 2,6-dimethyl-3-hydroxy-4H-pyran-4-one, NSC20756, 4H-Pyran-4-one,3-hydroxy-2,6-dimethyl-, CHEMBL122155, SCHEMBL2590278, XDEZVFBBUCLCGZ-UHFFFAOYSA-N, DTXCID201017117, NSC-20756, DS-005387, 3-Hydroxy-2,6-dimethyl-4H-pyran-4-one # |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 46.5 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCCCC1 |
| Np Classifier Class | 4-pyrone derivatives |
| Deep Smiles | Cccc=O)cco6)C))O |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Pyrans |
| Scaffold Graph Node Level | OC1CCOCC1 |
| Classyfire Subclass | Pyranones and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 235.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-hydroxy-2,6-dimethylpyran-4-one |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 0.7 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C7H8O3 |
| Scaffold Graph Node Bond Level | O=c1ccocc1 |
| Inchi Key | XDEZVFBBUCLCGZ-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | 3-hydroxy-2,6-dimethyl-4h-pyran-4-one |
| Esol Class | Very soluble |
| Functional Groups | c=O, cO, coc |
| Compound Name | 4H-Pyran-4-one, 3-hydroxy-2,6-dimethyl- |
| Exact Mass | 140.047 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 140.047 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 140.14 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C7H8O3/c1-4-3-6(8)7(9)5(2)10-4/h3,9H,1-2H3 |
| Smiles | CC1=CC(=O)C(=C(O1)C)O |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Cyclic polyketides |
- 1. Outgoing r'ship
FOUND_INto/from Fragaria Vesca (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3095