Hexdecanoic acid hydrazide
PubChem CID: 225536
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2619-88-7, hexadecanehydrazide, Palmitic Acid Hydrazide, Palmitohydrazide, Hexadecanoic acid, hydrazide, hexadecanoyl hydrazide, HEXDECANOIC ACID HYDRAZIDE, Hexadecanoic acid,hydrazide, NSC15077, MFCD00066357, Hexadecanohydrazide #, 16-Hexadecanoyl hydrazide, SCHEMBL765585, DTXSID20280004, ALBB-002521, BBL028108, NSC-15077, STK502495, AKOS005171043, SB85898, AS-59435, CS-0197094, P0004, D91886, 667-071-3 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 55.1 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Primary amides |
| Deep Smiles | CCCCCCCCCCCCCCCC=O)NN |
| Heavy Atom Count | 19.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Classyfire Subclass | Carboxylic acid derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 195.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | hexadecanehydrazide |
| Nih Violation | True |
| Veber Rule | False |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | 5.3 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C16H34N2O |
| Inchi Key | SSVSELJXJJCANX-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 14.0 |
| Synonyms | palmitic acid hydrazide |
| Esol Class | Soluble |
| Functional Groups | CC(=O)NN |
| Compound Name | Hexdecanoic acid hydrazide |
| Exact Mass | 270.267 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 270.267 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 270.45 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C16H34N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(19)18-17/h2-15,17H2,1H3,(H,18,19) |
| Smiles | CCCCCCCCCCCCCCCC(=O)NN |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty amides |
- 1. Outgoing r'ship
FOUND_INto/from Jatropha Curcas (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.886965