2-Methylbutyrate
PubChem CID: 22253297
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-Methylbutyrate, 2-methylbutanoate, alpha-methylbutyrate, CHEBI:48946, (+/-)-2-methylbutanoate, WLAMNBDJUVNPJU-UHFFFAOYSA-M, BDBM50240453, Q27121397 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 40.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Deep Smiles | [O-]C=O)CCC))C |
| Heavy Atom Count | 7.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty acids and conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 63.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-methylbutanoate |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 1.8 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H9O2- |
| Inchi Key | WLAMNBDJUVNPJU-UHFFFAOYSA-M |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | α-methyl butyrate |
| Esol Class | Very soluble |
| Functional Groups | CC(=O)[O-] |
| Compound Name | 2-Methylbutyrate |
| Exact Mass | 101.06 |
| Formal Charge | -1.0 |
| Monoisotopic Mass | 101.06 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 101.12 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/p-1 |
| Smiles | CCC(C)C(=O)[O-] |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Trachyspermum Ammi (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2019.1612281