Ethyl behenate
PubChem CID: 22199
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ETHYL DOCOSANOATE, 5908-87-2, Ethyl behenate, Behenic acid ethyl ester, docosanoic acid ethyl ester, Docosanoic acid, ethyl ester, ethyl docosenyl, P3XW559OLD, EINECS 227-616-4, DTXSID80207813, BEHENIC ACID ETHYL ESTER [MI], WE(2:0/22:0), Behenic Acid Ethyl Ester (>90%), UNII-P3XW559OLD, Ethyl docosanoate #, SCHEMBL25276, QSPL 172, DTXCID30130304, CHEBI:180074, FAA90887, LMFA07010476, AKOS022172024, HY-W556168, BP-29809, BS-48968, DB-053318, NS00034078, E78562, Q27286097, 227-616-4 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Wax monoesters |
| Deep Smiles | CCCCCCCCCCCCCCCCCCCCCC=O)OCC |
| Heavy Atom Count | 26.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty acid esters |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 275.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | ethyl docosanoate |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 11.1 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C24H48O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | JIZCYLOUIAIZHQ-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.9583333333333334 |
| Logs | -7.264 |
| Rotatable Bond Count | 22.0 |
| Logd | 4.684 |
| Synonyms | ethyl docosanoate |
| Esol Class | Poorly soluble |
| Functional Groups | COC(C)=O |
| Compound Name | Ethyl behenate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 368.365 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 368.365 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 368.6 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -7.6855052000000015 |
| Inchi | InChI=1S/C24H48O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26-4-2/h3-23H2,1-2H3 |
| Smiles | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Fatty esters |
- 1. Outgoing r'ship
FOUND_INto/from Aglaia Cordata (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Aleurites Cordata (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Alnus Cordata (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Aralia Cordata (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Buddleja Cordata (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Carpinus Cordata (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Circaea Cordata (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Drymaria Cordata (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Eucalyptus Cordata (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Ficus Cordata (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Houttuynia Cordata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Macleaya Cordata (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Melia Azadirachta (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Melia Azedarach (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Melia Composita (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Melia Dubia (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Melia Indica (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Mikania Cordata (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Orymaria Cordata (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Salacia Cordata (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Sida Cordata (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Spondias Mombin (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2005.9698933 - 23. Outgoing r'ship
FOUND_INto/from Swertia Cordata (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Telosma Cordata (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Tilia Cordata (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Trichosanthes Cordata (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Uncaria Cordata (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Vitis Vinifera (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2010.9700415