Lup-20(29)-ene-3beta,28-diol
PubChem CID: 221023
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Lup-20(29)-ene-3,28-diol, 3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol, Lup-20(29)-ene-3.beta.,28-diol, NSC4644, NSC692218, AI3-62999, Trochol, Oprea1_601334, 3aH-Cyclopenta[a]chrysene, lup-20(29)-ene-3,28-diol deriv., SCHEMBL17749655, FVWJYYTZTCVBKE-UHFFFAOYSA-N, 7372-31-8, BCP28193, Lup-20(30)-ene-3,28-diol, STL377780, AKOS040894266, Lup-20(29)-ene-3, (3.beta.)-, NCI60_004094, 3a-(hydroxymethyl)-1-isopropenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
|---|---|
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | FVWJYYTZTCVBKE-UHFFFAOYSA-N |
| Rotatable Bond Count | 2.0 |
| Synonyms | (3beta)-Lup-20(29)-ene-3,28-diol, Betulenol, Betulin, Betuline, Betulinic alcohol, Betulinol, Betulinol (obsol.), Betulol, Lup-20(29)-ene-3 beta,28-diol, Lup-20(29)-ene-3,28-diol, (3&beta, )-, Lup-20(29)-ene-3,28-diol, (3beta)-, Lup-20(29)-ene-3&beta, ,28-diol, Lup-20(29)-ene-3beta ,28-diol, Lup-20(29)-ene-3beta,28-diol, Lup-20(30)-ene-3&beta, ,28-diol, Lup-20(30)-ene-3beta ,28-diol, Lup-20(30)-ene-3beta,28-diol, Messagenin, Trochol |
| Heavy Atom Count | 32.0 |
| Compound Name | Lup-20(29)-ene-3beta,28-diol |
| Description | Constituent of Corylus avellana (filbert) and Vicia faba Betulin (lup-20(29)-ene-3?,28-diol) is an abundant naturally occurring triterpene. It is commonly isolated from the bark of birch trees and forms up to 30% of the dry weight of the extractive. The purpose of the compound in the bark is not known. It can be converted to betulinic acid (the alcohol group replaced by a carboxylic acid group), which is biologically more active than betulin itself., Chemically, betulin is a triterpenoid of lupane structure. It has a pentacyclic ring structure, and hydroxyl groups in positions C3 and C28. Betulin is found in many foods, some of which are common walnut, common sage, nuts, and common hazelnut. |
| Exact Mass | 442.381 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 442.381 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 786.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 442.7 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
| Total Atom Stereocenter Count | 10.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C30H50O2/c1-19(2)20-10-15-30(18-31)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h20-25,31-32H,1,8-18H2,2-7H3 |
| Smiles | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)CO |
| Xlogp | 8.3 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C30H50O2 |
- 1. Outgoing r'ship
FOUND_INto/from Castanea Sativa (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Cichorium Intybus (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Corylus Avellana (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Diospyros Kaki (Plant) Rel Props:Source_db:fooddb_chem_all - 5. Outgoing r'ship
FOUND_INto/from Diospyros Virginiana (Plant) Rel Props:Source_db:fooddb_chem_all - 6. Outgoing r'ship
FOUND_INto/from Garcinia Mangostana (Plant) Rel Props:Source_db:fooddb_chem_all - 7. Outgoing r'ship
FOUND_INto/from Juglans Regia (Plant) Rel Props:Source_db:fooddb_chem_all - 8. Outgoing r'ship
FOUND_INto/from Rosmarinus Officinalis (Plant) Rel Props:Source_db:fooddb_chem_all - 9. Outgoing r'ship
FOUND_INto/from Salvia Officinalis (Plant) Rel Props:Source_db:fooddb_chem_all - 10. Outgoing r'ship
FOUND_INto/from Sambucus Nigra (Plant) Rel Props:Source_db:fooddb_chem_all - 11. Outgoing r'ship
FOUND_INto/from Vicia Faba (Plant) Rel Props:Source_db:fooddb_chem_all