D-erythro-D-galacto-Octitol
PubChem CID: 219890
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | D-erythro-D-galacto-Octitol, octan-1,2,3,4,5,6,7,8-octol, Octitol, NSC1671, Octitol #, d-Gala-l-ido-octitol, octane-1,2,3,4,5,6,7,8-octol, SCHEMBL1110753, L-ERYTHRO-L-GULO-OCTITOL, CHEBI:165245, DRDSDQVQSRICML-UHFFFAOYSA-N, NSC-1671 |
|---|---|
| Topological Polar Surface Area | 162.0 |
| Hydrogen Bond Donor Count | 8.0 |
| Heavy Atom Count | 16.0 |
| Description | Isolated from avocado. D-erythro-D-galacto-octitol is found in avocado and fruits. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 169.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | octane-1,2,3,4,5,6,7,8-octol |
| Nih Violation | True |
| Class | Organooxygen compounds |
| Xlogp | -4.3 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Molecular Formula | C8H18O8 |
| Inchi Key | DRDSDQVQSRICML-UHFFFAOYSA-N |
| Rotatable Bond Count | 7.0 |
| State | Solid |
| Compound Name | D-erythro-D-galacto-Octitol |
| Kingdom | Organic compounds |
| Exact Mass | 242.1 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 242.1 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 242.22 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Inchi | InChI=1S/C8H18O8/c9-1-3(11)5(13)7(15)8(16)6(14)4(12)2-10/h3-16H,1-2H2 |
| Smiles | C(C(C(C(C(C(C(CO)O)O)O)O)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Sugar alcohols |
- 1. Outgoing r'ship
FOUND_INto/from Persea Americana (Plant) Rel Props:Source_db:fooddb_chem_all