glycero-galacto-Heptose
PubChem CID: 219662
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | d-Glycero-d-galacto-heptose, Heptose, D-Mannoheptose, 5328-64-3, L-glycero-D-gluco-Heptose, glycero-galacto-Heptose, 2,3,4,5,6,7-hexahydroxyheptanal, D-Glycero-D-galactoheptose, NSC 1977, Glucoheptose, d-Glucoheptose, 7634-39-1, B-D-GALACTOHEPTOSE, 62475-58-5, 84142-51-8, b-L-Galactoheptose, d-Glycero-d-ido-heptose, Heptose #, .alpha.-gluco-Heptose, D-Mannoheptose, >=99%, SCHEMBL169684, DTXSID70940323, NSC1224, NSC1977, NSC2555, NSC-1224, NSC-1977, NSC-2555, MG02812, SB46636, DB-054173, 226B07D4-6A60-42AA-BB4F-CC300BF44698 |
|---|---|
| Topological Polar Surface Area | 138.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Heavy Atom Count | 14.0 |
| Description | D-glycero-d-galactoheptose is a member of the class of compounds known as heptoses. Heptoses are monosaccharides in which the sugar unit is a seven-carbon containing moeity. D-glycero-d-galactoheptose is soluble (in water) and a very weakly acidic compound (based on its pKa). D-glycero-d-galactoheptose can be found in avocado, which makes D-glycero-d-galactoheptose a potential biomarker for the consumption of this food product. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 173.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,3,4,5,6,7-hexahydroxyheptanal |
| Nih Violation | True |
| Class | Organooxygen compounds |
| Xlogp | -3.6 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Molecular Formula | C7H14O7 |
| Inchi Key | YPZMPEPLWKRVLD-UHFFFAOYSA-N |
| Rotatable Bond Count | 6.0 |
| Synonyms | D-glucoheptose, D-glycero-d-gulo-heptose, D-glycero-d-ido-heptose, D-glycero-d-tallo-heptose, D-glycero-l-gluco-heptose, D-glycero-l-manno-heptose, D-mannoheptose, Glycero-galacto-heptose, Heptose, Glycero-galacto-heptose, (D-glycero-L-galacto)-isomer |
| Compound Name | glycero-galacto-Heptose |
| Kingdom | Organic compounds |
| Exact Mass | 210.074 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 210.074 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 210.18 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Inchi | InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h1,3-7,9-14H,2H2 |
| Smiles | C(C(C(C(C(C(C=O)O)O)O)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Heptoses |
- 1. Outgoing r'ship
FOUND_INto/from Persea Americana (Plant) Rel Props:Source_db:fooddb_chem_all