5,7,4'-Trihydroxyisoflavanone 7-O-glucoside
PubChem CID: 21941294
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5,7,4'-Trihydroxyisoflavanone 7-O-glucoside |
|---|---|
| Topological Polar Surface Area | 166.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | HZFUHKPAKUYSOB-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | 5,7,4'-Trihydroxyisoflavanone 7-O-glucoside, Dihydrogenistin |
| Heavy Atom Count | 31.0 |
| Compound Name | 5,7,4'-Trihydroxyisoflavanone 7-O-glucoside |
| Description | Constituent of Glycine max (soybeans). Dihydrogenistin is found in soy bean and pulses. |
| Exact Mass | 434.121 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 434.121 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 623.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 434.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5-hydroxy-3-(4-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| Total Atom Stereocenter Count | 6.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C21H22O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-5-13(24)16-14(6-11)29-8-12(17(16)25)9-1-3-10(23)4-2-9/h1-6,12,15,18-24,26-28H,7-8H2 |
| Smiles | C1C(C(=O)C2=C(C=C(C=C2O1)OC3C(C(C(C(O3)CO)O)O)O)O)C4=CC=C(C=C4)O |
| Xlogp | 0.8 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C21H22O10 |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all