Potassium
PubChem CID: 21902456
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 80.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | True |
| Deep Smiles | [O-]C=O)CCC=O)[O-].[K+] |
| Heavy Atom Count | 9.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Classyfire Subclass | Dicarboxylic acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 81.6 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | potassium, butanedioate |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C4H4KO4- |
| Inchi Key | PWARIDJUMWYDTK-UHFFFAOYSA-L |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | potasium-succinate, potassium-succinate |
| Esol Class | Very soluble |
| Functional Groups | CC(=O)[O-], [K+] |
| Compound Name | Potassium, butanedioate |
| Exact Mass | 154.975 |
| Formal Charge | -1.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 154.975 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 155.17 |
| Gi Absorption | False |
| Covalent Unit Count | 2.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C4H6O4.K/c5-3(6)1-2-4(7)8, /h1-2H2,(H,5,6)(H,7,8), /q, +1/p-2 |
| Smiles | C(CC(=O)[O-])C(=O)[O-].[K+] |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
- 1. Outgoing r'ship
FOUND_INto/from Achyranthes Bidentata (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279