1-[(4-hydroxyphenyl)methyl]-7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol
PubChem CID: 21817819
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | CHEMBL3828751, SCHEMBL12807694 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 52.9 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC(CC2CCCC3CCCCC32)CC1 |
| Np Classifier Class | Isoquinoline alkaloids, Tetrahydroisoquinoline alkaloids |
| Deep Smiles | COcccccc6O)))CCNC6Ccccccc6))O)))))))C |
| Heavy Atom Count | 22.0 |
| Classyfire Class | Isoquinolines and derivatives |
| Scaffold Graph Node Level | C1CCC(CC2NCCC3CCCCC32)CC1 |
| Classyfire Subclass | Benzylisoquinolines |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 356.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | O42275, P81908 |
| Iupac Name | 1-[(4-hydroxyphenyl)methyl]-7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 3.0 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C18H21NO3 |
| Scaffold Graph Node Bond Level | c1ccc(CC2NCCc3ccccc32)cc1 |
| Prediction Swissadme | 1.0 |
| Inchi Key | HTSOYRHMEMWMRT-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.3333333333333333 |
| Logs | -1.781 |
| Rotatable Bond Count | 3.0 |
| Logd | 2.78 |
| Synonyms | n-methylisococlaurine |
| Esol Class | Soluble |
| Functional Groups | CN(C)C, cO, cOC |
| Compound Name | 1-[(4-hydroxyphenyl)methyl]-7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 299.152 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 299.152 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 299.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.816930363636364 |
| Inchi | InChI=1S/C18H21NO3/c1-19-8-7-13-10-17(21)18(22-2)11-15(13)16(19)9-12-3-5-14(20)6-4-12/h3-6,10-11,16,20-21H,7-9H2,1-2H3 |
| Smiles | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tyrosine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Anacolosa Densiflora (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Blumea Densiflora (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Cocos Nucifera (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Corydalis Densiflora (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Cryptocarya Alba (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Cryptocarya Amygdalina (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Cryptocarya Aschersoniana (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Cryptocarya Bourdillonii (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Cryptocarya Chinensis (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Cryptocarya Infectoria (Plant) Rel Props:Source_db:npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Cryptocarya Lividula (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Cryptocarya Longifolia (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Cryptocarya Oblata (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Cryptocarya Triplinervis (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Cryptocarya Wightiana (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Ficus Infectoria (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Nelumbo Lutea (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Nelumbo Nucifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Pinus Densiflora (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Quercus Infectoria (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Rauvolfia Densiflora (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Rotala Densiflora (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Swertia Densiflora (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Torreya Nucifera (Plant) Rel Props:Reference: