Mahanimbidine
PubChem CID: 21770913
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Mahanimbidine, Murrayazoline, (+)-Murrayazoline, 25488-37-3, 1,12-Epoxy-9H-indolo[3,2,1-de]phenanthridine, 9a,10,11,12,13,13a-hexahydro-2,9,9,12-tetramethyl-, (9aR,12S,13aS)-, CHEMBL524719, DTXSID401316331, HY-N11023, AKOS040735198, (14R,17S,19S)-3,13,13,17-tetramethyl-21-oxa-12-azahexacyclo[10.7.1.12,17.05,20.06,11.014,19]henicosa-1,3,5(20),6,8,10-hexaene |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 14.2 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)C1CCC3CC4CCC5CC2C1C3C5C4 |
| Np Classifier Class | Carbazole alkaloids |
| Deep Smiles | Cccccccccc6nc9cc%13O[C@@]C)CC[C@H][C@@H]8C6))C%10C)C |
| Heavy Atom Count | 25.0 |
| Classyfire Class | Quinolines and derivatives |
| Scaffold Graph Node Level | C1CCC2C(C1)C1CCC3OC4CCC5CN2C1C3C5C4 |
| Classyfire Subclass | Benzoquinolines |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 587.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Uniprot Id | n.a. |
| Iupac Name | (14R,17S,19S)-3,13,13,17-tetramethyl-21-oxa-12-azahexacyclo[10.7.1.12,17.05,20.06,11.014,19]henicosa-1,3,5(20),6,8,10-hexaene |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 5.2 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C23H25NO |
| Scaffold Graph Node Bond Level | c1ccc2c(c1)c1ccc3c4c1n2CC1CCC(CC41)O3 |
| Prediction Swissadme | 0.0 |
| Inchi Key | YPSWCORASQDCJM-MFEFFIJZSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.4782608695652174 |
| Logs | -7.179 |
| Rotatable Bond Count | 0.0 |
| Logd | 4.865 |
| Synonyms | curryangine, mahanimbidine, murrayazoline |
| Esol Class | Moderately soluble |
| Functional Groups | cOC, cn(c)C |
| Compound Name | Mahanimbidine |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 331.194 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 331.194 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 331.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -5.524345800000001 |
| Inchi | InChI=1S/C23H25NO/c1-13-11-15-14-7-5-6-8-18(14)24-20(15)19-16-12-23(4,25-21(13)19)10-9-17(16)22(24,2)3/h5-8,11,16-17H,9-10,12H2,1-4H3/t16-,17+,23-/m0/s1 |
| Smiles | CC1=CC2=C3C4=C1O[C@]5(CC[C@H]([C@@H]4C5)C(N3C6=CC=CC=C62)(C)C)C |
| Nring | 6.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tryptophan alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Acalypha Paniculata (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Acmella Paniculata (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Acypha Paniculata (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Afraegle Paniculata (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Andrographis Paniculata (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Ardisia Paniculata (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Cassine Paniculata (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Clausena Euchrestifolia (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Coussarea Paniculata (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Crotalaria Paniculata (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Dalbergia Lanceolaria (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Dbergia Paniculata (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Diospyros Paniculata (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Erycibe Paniculata (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Flemingia Paniculata (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Gymnacranthera Paniculata (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Hydrangea Paniculata (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Ipomoea Paniculata (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Jacquemontia Paniculata (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Justicia Paniculata (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Koelreuteria Paniculata (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Meconopsis Paniculata (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Microcos Paniculata (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Murraya Alata (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Murraya Crenulata (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Murraya Elongata (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Murraya Euchrestifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 28. Outgoing r'ship
FOUND_INto/from Murraya Exotica (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Murraya Koenigii (Plant) Rel Props:Reference:ISBN:9788172360818; ISBN:9788185042053; ISBN:9788185042084 - 30. Outgoing r'ship
FOUND_INto/from Murraya Kwangsiensis (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Murraya Microphylla (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Murraya Paniculata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 33. Outgoing r'ship
FOUND_INto/from Murraya Siamensis (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Onosma Paniculata (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Ostodes Paniculata (Plant) Rel Props:Reference: - 36. Outgoing r'ship
FOUND_INto/from Oxyspora Paniculata (Plant) Rel Props:Reference: - 37. Outgoing r'ship
FOUND_INto/from Porana Paniculata (Plant) Rel Props:Reference: - 38. Outgoing r'ship
FOUND_INto/from Sasa Paniculata (Plant) Rel Props:Reference: - 39. Outgoing r'ship
FOUND_INto/from Spilanthes Paniculata (Plant) Rel Props:Reference: - 40. Outgoing r'ship
FOUND_INto/from Stevia Paniculata (Plant) Rel Props:Reference: - 41. Outgoing r'ship
FOUND_INto/from Swertia Paniculata (Plant) Rel Props:Reference: - 42. Outgoing r'ship
FOUND_INto/from Symplocos Paniculata (Plant) Rel Props:Reference: - 43. Outgoing r'ship
FOUND_INto/from Terminalia Paniculata (Plant) Rel Props:Reference: - 44. Outgoing r'ship
FOUND_INto/from Vitex Paniculata (Plant) Rel Props:Reference: - 45. Outgoing r'ship
FOUND_INto/from Wendlandia Paniculata (Plant) Rel Props:Reference: