Epigallocatechin 3-O-cinnamate
PubChem CID: 21629801
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Epigallocatechin 3-O-cinnamate, (-)-Epigallocatechin 3-cinnamate, 108907-46-6, (E)-(2R,3R)-5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl cinnamate, 3-Cinnamoylepigallocatechin, Epigallocatechin 3-cinnamate, CHEBI:175514, DTXSID201103544, (-)-Epigallocatechin 3-O-cinnamate, LMPK12020116, [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] (E)-3-phenylprop-2-enoate, 2-Propenoic acid, 3-phenyl-, 3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester, [2R-[2I+/-,3I+/-(E)]]- |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 137.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC(CCC1CCCCC1)CC1CC2CCCCC2CC1C1CCCCC1 |
| Np Classifier Class | Flavan-3-ols |
| Deep Smiles | O=CO[C@@H]CccO)cccc6O[C@@H]%10cccO)ccc6)O))O)))))))))O))))))))/C=C/cccccc6 |
| Heavy Atom Count | 32.0 |
| Classyfire Class | Flavonoids |
| Description | Isolated from Assam tea (Camellia sinensis variety assamica). Epigallocatechin 3-cinnamate is found in tea. |
| Scaffold Graph Node Level | OC(CCC1CCCCC1)OC1CC2CCCCC2OC1C1CCCCC1 |
| Classyfire Subclass | Flavans |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 650.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] (E)-3-phenylprop-2-enoate |
| Prediction Hob | 0.0 |
| Class | Flavonoids |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 2.7 |
| Superclass | Phenylpropanoids and polyketides |
| Subclass | Flavans |
| Gsk 4 400 Rule | False |
| Molecular Formula | C24H20O8 |
| Scaffold Graph Node Bond Level | O=C(C=Cc1ccccc1)OC1Cc2ccccc2OC1c1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | GQGIIUWXMCBYIJ-UMMIVNDFSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.125 |
| Rotatable Bond Count | 5.0 |
| Synonyms | (-)-Epigallocatechin 3-cinnamate, (-)-Epigallocatechin 3-O-cinnamate, 3-Cinnamoylepigallocatechin, Epigallocatechin 3-cinnamate, Epigallocatechin 3-O-cinnamate, (-)-Epigallocatechin 3-cinnamic acid, Epigallocatechin 3-O-cinnamic acid, Epigallocatechin 3-cinnamic acid, b-Sitosterol behenate, 14-(5-Ethyl-6-methylheptan-2-yl)-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-5-yl docosanoic acid, b-Sitosterol behenic acid, beta-Sitosterol behenic acid, Β-sitosterol behenate, Β-sitosterol behenic acid, 3-o-cinnamoyl-epigallocatechin |
| Esol Class | Moderately soluble |
| Functional Groups | c/C=C/C(=O)OC, cO, cOC |
| Compound Name | Epigallocatechin 3-O-cinnamate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 436.116 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 436.116 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 436.4 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -4.307829200000001 |
| Inchi | InChI=1S/C24H20O8/c25-15-10-17(26)16-12-21(31-22(29)7-6-13-4-2-1-3-5-13)24(32-20(16)11-15)14-8-18(27)23(30)19(28)9-14/h1-11,21,24-28,30H,12H2/b7-6+/t21-,24-/m1/s1 |
| Smiles | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)/C=C/C4=CC=CC=C4 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Epigallocatechins |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all