2-Piperidineethanol, alpha-methyl-, (R*,R*)-(+-)-
PubChem CID: 213522
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (+-)-Sedridine, Sedridine, (+-)-, 2-Piperidineethanol, alpha-methyl-, (R*,R*)-(+-)-, 26619-80-7, (R*,R*)-(+-)-alpha-Methyl-2-piperidineethanol, DTXSID40181165, Sedridine, (+-)-(8CI), DTXCID50103656, AKOS006351703 |
|---|---|
| Topological Polar Surface Area | 32.299 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | GFKFBLJVPWRDEL-HTQZYQBOSA-N |
| Rotatable Bond Count | 2.0 |
| Synonyms | (+-)-sedridine, (R*,R*)-(+-)-alpha-Methyl-2-piperidineethanol, 2-Piperidineethanol, alpha-methyl-, (R*,R*)-(+-)-, Sedridine, (+-)-, Sedridine, (+-)- (8CI) |
| Heavy Atom Count | 10.0 |
| Compound Name | 2-Piperidineethanol, alpha-methyl-, (R*,R*)-(+-)- |
| Kingdom | Organic compounds |
| Description | Sedridine is a member of the class of compounds known as piperidines. Piperidines are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. Sedridine is soluble (in water) and an extremely weak acidic compound (based on its pKa). Sedridine can be found in pomegranate, which makes sedridine a potential biomarker for the consumption of this food product. |
| Exact Mass | 143.131 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 143.131 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 95.3 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 143.23 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (2R)-1-[(2R)-piperidin-2-yl]propan-2-ol |
| Total Atom Stereocenter Count | 2.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Piperidines |
| Inchi | InChI=1S/C8H17NO/c1-7(10)6-8-4-2-3-5-9-8/h7-10H,2-6H2,1H3/t7-,8-/m1/s1 |
| Smiles | C[C@H](C[C@H]1CCCCN1)O |
| Xlogp | 0.8 |
| Superclass | Organoheterocyclic compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Piperidines |
| Molecular Formula | C8H17NO |
- 1. Outgoing r'ship
FOUND_INto/from Punica Granatum (Plant) Rel Props:Source_db:fooddb_chem_all