Norleucine
PubChem CID: 21236
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | L-Norleucine, NORLEUCINE, 327-57-1, (S)-2-Aminohexanoic acid, H-Nle-OH, L-(+)-Norleucine, (2S)-2-aminohexanoic acid, Glycoleucine, Caprine, L-2-Aminohexanoate, L-2-Aminohexanoic acid, 2-Aminocaproic acid, Hexanoic acid, 2-amino-, (S)-, L-Aminohexanoate, alpha-Aminocaproic acid, Norleucine, L-, Norleucine (VAN), L(+)-Norleucine, (S)-(+)-2-Aminohexanoic acid, L-Aminohexanoic acid, NSC 10378, 2S-amino-hexanoic acid, (S)-2-Aminocaproic acid, (S)-Norleucine, EINECS 206-321-4, BRN 1721750, CHEBI:18347, 2-amino-hexanoic acid, 832C8OV84S, NORLEUCINE [MI], MFCD00064423, NSC-10378, DTXSID70883362, 4-04-00-02686 (Beilstein Handbook Reference), NLE, (S)-2-aminohexanoate, S-2-aminohexanoic acid, .alpha.-Aminocaproic acid, (S)-2-amino-Hexanoic acid, UNII-832C8OV84S, 2-Aminocaproate, 2-Aminohexanoate, (S)-Aminohexanoate, (S)-Aminohexanoic acid, H-Nle-OH L-Norleucine, (S)-2-amino-Hexanoate, (S)-2-aminohexanoicacid, hexanoic acid, 2-amino-, bmse000411, (2S)-2-azaniumylhexanoate, SCHEMBL8393, n-C4H9CH(NH2)COOH, N6877_SIGMA, CHEMBL292439, (S)-()-2-Aminohexanoic acid, L-Norleucine, >=98% (TLC), DTXCID201022899, 496-90-2, HY-Y0017, FD3031, LMFA01100042, AKOS006240047, CS-W020710, DB15458, FN46957, AC-22372, AS-13136, N0303, NS00074199, C01933, EN300-134822, M03242, L-2-Aminohexanoic acid, (S)-2-Aminocaproic acid, Q415428, B9CD20C9-2708-47D2-BEF1-0BA8BB0628AC, Z1203162297, L-Norleucine, suitable for amino acid analysis, BioReagent, 206-321-4 |
|---|---|
| Topological Polar Surface Area | 63.3 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 9.0 |
| Description | An unnatural amino acid that is used experimentally to study protein structure and function. It is structurally similar to methionine, however it does not contain sulfur. Aminocaproic acid works as an antifibrinolytic. It is a derivative of the amino acid lysine. It binds reversibly to the kringle domain of plasminogen and blocks the binding of plasminogen to fibrin and its activation to plasmin. [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 93.1 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | (2S)-2-aminohexanoic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Carboxylic acids and derivatives |
| Xlogp | -1.5 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C6H13NO2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | LRQKBLKVPFOOQJ-YFKPBYRVSA-N |
| Fcsp3 | 0.8333333333333334 |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Synonyms | (S)-2-amino-Hexanoate, (S)-2-amino-Hexanoic acid, (S)-2-Aminohexanoate, (S)-2-Aminohexanoic acid, (S)-Aminohexanoate, (S)-Aminohexanoic acid, (S)-Norleucine, 2-Aminocaproate, 2-Aminocaproic acid, 2-Aminohexanoate, 2-Aminohexanoic acid, a-Aminocaproate, a-Aminocaproic acid, alpha-Aminocaproate, alpha-Aminocaproic acid, Caprine, Glycoleucine, L-(+)-Norleucine, L-2-Aminohexanoate, L-2-Aminohexanoic acid, L-Aminohexanoate, L-Aminohexanoic acid, L-Norleucine, L(+)-Norleucine, Nle, Norleucine, α-aminocaproate, α-aminocaproic acid, Α-aminocaproate, Α-aminocaproic acid, L-Isomer norleucine, Norleucine, L isomer, Norleucine, L-isomer, 2S-Amino-hexanoate |
| Substituent Name | L-alpha-amino acid, Medium-chain fatty acid, Amino fatty acid, Fatty acyl, Fatty acid, Monocarboxylic acid or derivatives, Carboxylic acid, Hydrocarbon derivative, Primary amine, Organooxygen compound, Organonitrogen compound, Primary aliphatic amine, Carbonyl group, Amine, Aliphatic acyclic compound |
| Compound Name | Norleucine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 131.095 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 131.095 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 131.17 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | 0.5809150000000004 |
| Inchi | InChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1 |
| Smiles | CCCC[C@@H](C(=O)O)N |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | L-alpha-amino acids |
- 1. Outgoing r'ship
FOUND_INto/from Pogostemon Cablin (Plant) Rel Props:Source_db:cmaup_ingredients