6-Deoxy-L-talose
PubChem CID: 21123040
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 6-Deoxy-L-talose, 7658-10-8, (2R,3R,4R,5S)-2,3,4,5-Tetrahydroxyhexanal, SCHEMBL570933, CHEBI:194171, PNNNRSAQSRJVSB-AZGQCCRYSA-N, AKOS006271653, PD053739, CS-0535800 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 98.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Np Classifier Class | Monosaccharides |
| Deep Smiles | O=C[C@@H][C@@H][C@@H][C@@H]O)C))O))O))O |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Organooxygen compounds |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 126.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (2R,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal |
| Nih Violation | True |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -2.4 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C6H12O5 |
| Inchi Key | PNNNRSAQSRJVSB-AZGQCCRYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 4.0 |
| Synonyms | 6 deoxy-l-talose |
| Esol Class | Highly soluble |
| Functional Groups | CC=O, CO |
| Compound Name | 6-Deoxy-L-talose |
| Exact Mass | 164.068 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 164.068 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 164.16 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4-,5+,6-/m0/s1 |
| Smiles | C[C@@H]([C@H]([C@H]([C@H](C=O)O)O)O)O |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Saccharides |
- 1. Outgoing r'ship
FOUND_INto/from Ziziphus Jujuba (Plant) Rel Props:Reference:ISBN:9788171360536