2-Amino-3-hydroxybutanoic acid
PubChem CID: 205
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | DL-Threonine, 2-amino-3-hydroxybutanoic acid, 80-68-2, 7004-04-8, Allo-DL-threonine, DL-allo-Threonine, 144-98-9, DL-2-Amino-3-hydroxybutanoic acid, H-DL-Thr-OH, CHEBI:38263, 2-amino-3-hydroxy-butanoic acid, Allothreonine, D-, Butanoic acid, 2-amino-3-hydroxy-, 760PJT2SS0, DL-allothreonine, DTXSID301015364, H-DL-allo-Thr-OH, DL-Threonine (contains DL-Allothreonine), WLN: QY1&YZVQ -L, Threonine #, Butanoic acid, [R-(R*,S*)]-, Allothreonine, DL-, MFCD00063722, threonine(L), D(-)-allo-Threonine, 29NAP6417F, NSC46701, NSC-41828, NSC-206292, NCGC00164520-01, NCGC00164520-02, EINECS 205-645-3, MFCD00066665, D-Threonine, allo-free, THREONINE,(L), SCHEMBL1479, UNII-760PJT2SS0, 2-amino-3-hydroxybutanoicacid, CHEMBL30037, UNII-29NAP6417F, L-Threonine, non animal origin, DTXCID40210085, 2303597-29-5, BCP16820, NSC16589, NSC41828, NSC46702, BBL011585, NSC 41828, NSC206267, NSC206283, NSC206292, STL163323, AKOS000118925, AKOS016042347, FT08811, Butyric acid, alpha-amino-beta-hydroxy-, AS-14237, SY018620, SY020053, SY024226, SY026984, L-Threonine 2-Amino-3-hydroxybutyric acid, DB-047492, DB-054434, A0214, CS-0154977, NS00079068, NS00101103, T0229, T3105, EN300-18051, A20656, 2-Amino-3-hydroxybutanoic acid (H-DL-xiThr-OH), SR-01000944947, SR-01000944947-1, BUTYRIC ACID, .ALPHA.-AMINO-.BETA.-HYDROXY-, F3AB6CE6-3CF9-4C81-A7D7-7C21F24FDC0E, Q27117433, Q60662943, Z57127549, F2191-0228, (s)-threonine, L-alpha-Amino-beta-hydroxybutyric acid, l-threonin, Threonin, (2R,3S)-2-Amino-3-hydroxybutyric acid, D-alpha-Amino-beta-hydroxybutyric acid |
|---|---|
| Topological Polar Surface Area | 83.6 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | AYFVYJQAPQTCCC-UHFFFAOYSA-N |
| Rotatable Bond Count | 2.0 |
| Heavy Atom Count | 8.0 |
| Compound Name | 2-Amino-3-hydroxybutanoic acid |
| Description | Alpha-amino-beta-hydroxybutyric acid, also known as α-amino-β-hydroxybutyrate, is a member of the class of compounds known as alpha amino acids. Alpha amino acids are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha-amino-beta-hydroxybutyric acid is soluble (in water) and a moderately acidic compound (based on its pKa). Alpha-amino-beta-hydroxybutyric acid can be found in peanut, which makes alpha-amino-beta-hydroxybutyric acid a potential biomarker for the consumption of this food product. |
| Exact Mass | 119.058 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 119.058 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 93.3 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 119.12 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-3-hydroxybutanoic acid |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8) |
| Smiles | CC(C(C(=O)O)N)O |
| Xlogp | -2.9 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C4H9NO3 |
- 1. Outgoing r'ship
FOUND_INto/from Arachis Hypogaea (Plant) Rel Props:Source_db:fooddb_chem_all